5+10+13+?13+10+5 Which of the following symbols curly completes this com perforation

Answers

Answer 1
56 will end up as ur answer hope it helps

Related Questions

Eileen and her brother Andrew had a bicycle race. Eileen Rode at a speed of 20 ft per second while Andrew Rode at a speed of 15 ft./s. To be fair, Eileen decided to give Andrew a 150 foot Headstart. The race ended in a tie how far away was the finish line from where Eileen started include a graph to support your solution

Answers

Eileen was 600 feet away from the finish line before the race began.

Step-by-step explanation:

Step 1; Eileen rode at a speed of 20 feet per second whereas Andrew rode at a speed of 15 feet per second. So for every second that passes the distance in between decreases by 5 seconds. Assume x is the number of seconds at which the distance in between is 0. The distance in between at the beginning of the race is 150 feet due to the headstart.

Distance between them = Decreasing distance every second × x

150 feet = 5 feet/ second × x

x = 150 feet / 5 feet/second = 30 seconds.

So it takes Eileen 30 seconds to cover the distance between her and Andrew and cross the finishing line at the same time.

Step 2; The race lasted for 30 seconds so we can find the distance Andrew and Eileen traveled by multiplying their speed per second with the total number of seconds.

Distance Andrew traveled = speed per second × total number of seconds

= 15 feet per second × 30 seconds = 450 feet

Distance Eileen traveled = speed per second × total number of seconds

= 20 feet per second × 30 seconds = 600 feet

Graph plot;

The X-axis is time with 5 seconds for each cm

the y-axis is distance with 100 feet for each cm.

Eileen's plot (0,0), (5,100), (10,200), (15,300), (20,400), (25,500), (30,600).

Andrew's plot (0,150), (5,225), (10,300), (15,375), (20,450), (25,525), (30,600).

You randomly draw a marble out of a bag that contains 20 total marbles. 12 of the marbles in the bag are blue.
What is P(draw a blue marble)?
If necessary, round your answer to 2 decimal places.

Answers

Answer:

[tex]P(Blue)=0.60[/tex]

Step-by-step explanation:

Probability: [tex]Probability\ of\ an\ event=\frac{favourable\ outcome}{total\ outcome}[/tex]

[tex]Total\ marbles=20\\\\Hence\ total\ outcomes=20\\\\Blue\ marbles=12\\\\Hence\ favourable\ outcomes=12\\\\P(Blue)=\frac{12}{20}\\\\P(Blue)=\frac{2\times 6}{2\times 10}\\\\P(Blue)=\frac{6}{10}\\\\P(Blue)=0.60[/tex]

Are the polygons similar? If they are, choose the correct similarity statement and scale factor. Not drawn to scale.

Answers

Option B: [tex]$\Delta R S T \sim \Delta UV W ; \frac{5}{6}$[/tex]

Explanation:

The polygons are similar because in [tex]$\Delta R S T$[/tex], the measure of ∠R=32°

Also, in [tex]$\Delta U V W$[/tex], the measure of ∠U=32°

Now, we shall find the scale factor,

Since, [tex]$\Delta R S T \sim \Delta U V W$[/tex], then the sides are proportional which is given by,

[tex]\frac{RS}{UV}[/tex]

Substituting the values of RS and UV from the figure, we get,

[tex]\frac{10}{12}[/tex]

Simplifying, we have,

[tex]$\frac{5}{6}$[/tex]

Thus, the scale factor is [tex]$\frac{5}{6}$[/tex]

Hence, Option B is the correct answer.

Mr. Norris is paid a 5% commission on each boat he sells. What is his commission on a boat that he sells for $125,000?

Answers

Answer:

his commission would be $6250

Step-by-step explanation:

please give me brainly :)

Answer:

6250

Step-by-step explanation:

What’s the x-intercepts, vertex, y-intercept? y=(x+1)2-16

Answers

The vertex is (-1, -16)

x intercepts is : (3, 0) or (-5, 0)

y intercept is (0, -15)

Solution:

Given is:

[tex]y = (x+1)^2 - 16[/tex]

The vertex form of an equation is given as:

[tex]y = a(x-h)^2 + k[/tex]

Where, (h, k) is the vertex

On comparing the above equation with given,

h = -1

k = -16

Thus the vertex is (-1, -16)

Find the x intercept:

To find the x-intercept, substitute y = 0 in given

[tex]0 = (x + 1)^2 - 16\\\\x^2 + 2x + 1 - 16 = 0\\\\x^2 + 2x - 15 = 0\\\\Split\ the\ middle\ term\\\\x^2 - 3x +5x - 15 = 0\\\\(x^2 -3x) + (5x - 15) = 0\\\\x(x - 3) + 5(x - 3) = 0\\\\Factor\ out\ x - 3\\\\(x-3)(x + 5) = 0\\\\x = 3\\\\x = -5[/tex]

Thus x intercepts is : (3, 0) or (-5, 0)

Find the y intercept:

To find the y-intercept, substitute x = 0 in given

[tex]y = (0+1)^2 - 16\\\\y = 1 - 16\\\\y = -15[/tex]

Thus the y intercept is (0, -15)

Which expressions are equivalent to the one below? Check all that apply.
logg 5 + logs 125

Answers

Answer:

Step-by-step explanation:

B 4C and log 625

Two cars start at the same time, but travel in opposite directions. One car's average speed is 80 miles per hour (mph). At the end of 4 hours, the two cars are 520 miles apart. Find the average speed in mph of the other car. (Enter an exact number.

Answers

Final answer:

The average speed of the second car is calculated by subtracting the distance traveled by the first car from the total distance apart, and then dividing by the time elapsed. The second car has an average speed of 50 mph.

Explanation:

The student is asking for help to find the average speed of the second car when two cars, starting at the same point and traveling in opposite directions, end up being 520 miles apart after 4 hours. The first car travels at an average speed of 80 mph.

To solve this, we need to calculate the total distance covered by both cars in the time frame given. We already know the total distance apart is 520 miles.

The first car travels at 80 mph for 4 hours, covering 80 mph * 4 h = 320 miles. To find out how far the second car traveled, subtract the distance covered by the first car from the total distance apart: 520 miles - 320 miles = 200 miles.

Finally, to find the average speed of the second car, divide the distance traveled by the time. Thus, the second car's average speed is 200 miles / 4 h = 50 mph.

Final answer:

To find the average speed in mph of the other car, divide the total distance traveled by the time. Subtract the first car's average speed from the total speed to find the other car's average speed.

Explanation:

To find the average speed in mph of the other car, we need to determine the total distance traveled. Since the two cars are 520 miles apart at the end of 4 hours, we can divide the total distance by the time to find the average speed.

The first car has an average speed of 80 mph, so the total distance traveled by both cars is 80 mph * 4 hours = 320 miles.

The other car's average speed can be found by subtracting the first car's average speed from the total speed: 320 miles - 80 mph = 240 mph.

What is the equation of the line that has an x-intercept of 2 and a y-intercept of 8?
A y= 2x + 10
B y= 2x + 5
C y= -2x + 10
D y= -2x + 5

Answers

Answer:

x-int: (2, 0)

y-int: (0,8)

(8-0)/(0-2)= 8/-2=  -4

y - 0 = -4(x - 2)

y = -4x + 8

Step-by-step explanation:

group of baseball fans can see home plate from a 40 meter tall building outside the stadium. The angle of vision has a tangent of
9
4
. What is the horizontal distance, in meters, to home plate?

Answers

Answer:

17.78 meters

Step-by-step explanation:

Let

x ----> the horizontal distance, in meters, to home plate

[tex]\theta[/tex] ----> the angle of vision

we know that

[tex]tan(\theta)=\frac{40}{x}[/tex] ----> by TOA (opposite side divided by the adjacent side)

we have

[tex]tan(\theta)=\frac{9}{4}[/tex]

substitute

[tex]\frac{9}{4}=\frac{40}{x}[/tex]

solve for x

[tex]x=40(4)/9\\x=17.78\ m[/tex]

Describe and correct the error the student made when writing the equation of the line that passes through (-8,5)
and is perpendicular to y = 4x + 2
y-5 = 2(x-(-8))
y-5=+x+2
y-5+5 = 1x+2 +5
y=+x+7 X
Describe the error the student made. Select the correct choice below and, if necessary, fill in the answer box(es) to complete your choice.
O A. The student should have subtracted from both sides of the equation in order to isolate y.
O B. The student did not simplify the right side of the first equation correctly. Simplifying it correctly yields the equation y-5=
OC. The student should have substituted for X1 and for yı in the point-slope form y-yı = m(x-x1).
OD. The student should have used
as the slope of the perpendicular line.

Answers

Answer:

B. On Pearson (-1/4) D on Egdenuity(-1/4)

Final answer:

The student erred in calculating the slope for the line perpendicular to the given line. They should have used -1/4 instead of 2. The correct equation is y - 5 = -1/4 * (x + 8).

Explanation:

The error the student made lies in calculating the slope of the line that is perpendicular to given line y = 4x + 2. The slope of this line is 4, therefore the slope of the line perpendicular to it should be the negative reciprocal of 4, which is -1/4, not 2 as the student assumed. We also use the point-slope form of the line which is y - y1 = m(x - x1). Substituting m as -1/4 (the slope of perpendicular line) and the point (-8,5) into the equation, we should get y - 5 = -1/4 * (x + 8).

Learn more about Line Perpendicularity

https://brainly.com/question/1202004

#SPJ3

Bill spent less than 26$ on a magazine and five books. The magazine cost 4$
Write an inequality to represent the situation. Be sure to define your variable.
Solve the inequality to find the maximum cost each book.

Answers

Answer:

24 dollars

Step-by-step explanation:

6$for each one if u multiply then you'll get the number

Answer:

$24.00

Step-by-step explanation:

hope i helped

The population of growth of a town is 20,000 it decreased at a rate of 9% per year in about how many years will the population be fewer than 13,000

Answers

Answer:

4 years

Step-by-step explanation:

9% of the population is 1800. subtract that to get 18200. thats 1 year. subtract again to get 16400. thats 2 years. again to get 14600. 3 years. and then again to get 12800 which is less than 13000. so its 4 years.

Final answer:

Using the exponential decay formula, it takes approximately 8 years for a town's population of 20,000 to decrease to fewer than 13,000 at a yearly decrease rate of 9%.

Explanation:

The question involves calculating the number of years it takes for a town's population to decrease to fewer than 13,000 given an initial population of 20,000 and a yearly decrease rate of 9%. To solve this, we use the formula for exponential decay, which is P(t) = P₀[tex]e^{rt}[/tex], where P(t) is the population at time t, P0 is the initial population, r is the rate of decrease, and t is the time in years.

Substituting the given values, we have 13,000 = 20,000[tex]e^{-0.09t}[/tex]. Solving for t, we take natural logarithms on both sides, which gives ln(13,000/20,000) = -0.09t, leading to t = ln(13,000/20,000) / -0.09. This calculation yields t ≈ 8.04 years, meaning the population will be fewer than 13,000 in about 8 years.

This is a practical application of exponential decay in analyzing population dynamics, highlighting how populations decrease over time under consistent negative growth rates.

An artist is selling children's crafts. Necklaces cost $2.25 each, and bracelets cost $1.50 per each.

Select all the combinations of necklaces and bracelets that the artist could sell for exactly $12.00.
A:
5 necklaces and 1 bracelet
B:
2 necklaces and 5 bracelets
C:
3 necklaces and 3 bracelet
D:
4 necklaces and 2 bracelets
E:
3 necklaces and 5 bracelets
F:
6 necklaces and no bracelets
G:
No necklaces and 8 bracelets

Answers

Answer:

The combinations of necklaces and bracelets that the artist could sell for exactly $12.00 are

B: 2 necklaces and 5 bracelets

D: 4 necklaces and 2 bracelets

G: No necklaces and 8 bracelets

Step-by-step explanation:

let the number of necklace be x

the number of  bracelets be y

Then

The cost of one  necklace is $2.25

The cost of one bracelets is $1.50

Thus

x(2.25)  + y(1.50) = 12.00-------------------------(1)

Option A : 5 necklaces and 1 bracelet

(5)(2.25)  + (1)(1.50) = 12.00

11.25 +  1.50  =  12.00

12.75 > 12.00

Option B :2 necklaces and 5 bracelets

(2)(2.25)  + (5)(1.50) = 12.00

4.5 +  7.5 =  12.00

12. 00 = 12.00

Option C:  3 necklaces and 3 bracelets

(3)(2.25)  + (3)(1.50) = 12.00

6.75 + 4.50 =  12.00

11.25 < 12.00

Option D: 4 necklaces and 2 bracelets

(4)(2.25)  + (2)(1.50) = 12.00

9.00 + 3.00 = 12.00

12.00 =  12.00

Option E: 3 necklaces and 5 bracelets

(3)(2.25)  + (5)(1.50) = 12.00

6.75 + 7.5 = 12.00

14.25 >  12.00

Option F: 6 necklaces and no bracelets

(6)(2.25)  + (0)(1.50) = 12.00

13.5  + 0 = 12.00

13.5 > 12.00

Option G: No necklaces and 8 bracelets

(0)(2.25)  + (0)(1.50) = 12.00

0 +12.00= 12.00

12.00 =  12.00

The combinations of necklaces and bracelets that the artist could sell for exactly $12.00.

B: 2 necklaces and 5 bracelets

D: 4 necklaces and 2 bracelets

G: No necklaces and 8 bracelets

Since the artist is selling necklaces at $2.25 each, and bracelets at $1.50 per each, then the corresponding values will be:

2(2.25) + 5(1.50) = 4.50 + 7.50 = 12.00

4(2.25) + 2(1.50) = 9 + 3 = 12.00

0(2.25) + 8(1.50) = 0 + 12 = 12

In conclusion, the correct options are B, D, and G.

Read related link on:

https://brainly.com/question/15007030

Dante decided to spent only $20.00of his allowance and save the rest for later. Can he buy 12 packs of baseball cards?Why or why not​

Answers

Answer:

yessssssssssssssssssssssssss

Apply the distributive property to create an equivalent expression.
4\left(3 + \dfrac14c - \dfrac12d\right) =4(3+
4
1

c−
2
1

d)=

Answers

Answer:

[tex]12+c-2d[/tex]

Step-by-step explanation:

The correct expression of the problem is

[tex]4\left(3 + \dfrac14c - \dfrac12d\right)[/tex]

Applying the distributive property

[tex]4\left(3 + \dfrac14c - \dfrac12d\right)=(4*3)+(4*\dfrac{1}{4} c)-(4*\dfrac{1}{2} d)=(12)+(c)-(2d)[/tex]

therefore

The equivalent expression is equal to

[tex]12+c-2d[/tex]

Paleontologists believe the Diplodocus dinosaur weighed about 24,000 pounds. The
average person can lift 150 pounds. Approximately how many people would it take to lift
a Diplodocus?​

Answers

Answer:

  160 people

Step-by-step explanation:

  (24000 lb)/(150 lb/person) = (24000/150) persons = 160 persons

If the weight could be evenly distributed, it would take about 160 people to lift a diplodocus.

A classroom can accommodate less than 21 students.

Which of the following inequalities represents the number of students the classroom can accommodate?

Answers

Answer:

x<21

Step-by-step explanation:

How I always do it is I write down the number that was in the problem. So write down 21. Next I write down less. Then, if it says less, then the inequality sign's open side will face the number. This will be the opposite if the problem says more

Final answer:

The inequality representing a classroom that can accommodate fewer than 21 students is s < 21, which means the classroom can hold any number of students from 1 up to 20.

Explanation:

The question asks which inequality represents the number of students a classroom can accommodate if it can hold fewer than 21 students. To express this mathematically, we use an inequality sign. Since the classroom can accommodate less than 21 students, it means the number of students (let's call this number s) must be strictly less than 21. Therefore, the inequality that correctly represents this condition is s < 21.

This inequality means that any whole number of students from 1 up to 20 can fit in the classroom, as all these values are less than 21. It's crucial to understand that the inequality does not include 21 itself, because it specifies "less than," not "less than or equal to."

50 pounds to 35 pounds

Answers

50;35 pounds. proportion

50 pounds to 35 pound

That is 15 pound decrease and a 15/50 times 100 percent decrease.

15/50 x 100 = 30% decrease

answer: 30% decrease

Can someone explain the difference between the perimeter and the circumference?
REAL ANSWER PLEASE WILL GIVE BRAINLIEST

Answers

Answer:Perimeter is the limit of any given geometric figure. Circumference is just the name given to a circle’s perimeter, in other words, the circle’s limit, its edge.

The reason for this is because the perimeter is, by definition, the sum of the lenghth of every side of any given geometric figure. A circle has either no sides, or number of sides, so its perimeter has to be treated differently.

Remember that π (Pi) equals 3.141592 approximately. This is a constant, meaning that no matter what circle you are studying, Pi will always have the same value. It is the relation between the diameter and the lenght of its circumference. A circle with diameter xwill travel 3.141592x before it completes a revolution. This is where Pi comes from.

So the difference would be that a “normal” perimeter is only the sum of the sides. A circumference is the perimeter of a circle, given a diameter and the constant value of Pi, that derives from other properties of the circle, and not by its sides (remember a circle has either none or nnumber of sides).

perimeter is for a geometric shape (square, triangle, diamond, rectangle,etc.), whereas circumference is the “perimeter” of a circle

assume that y varies directly with x, then solve.
if y=2 2/3 when x=1/4, find y when x=1 1/8.
y=?

Answers

Answer:

12

Step-by-step explanation:

y = kx

2⅔ = k(¼)

8/3 = k/4

k = 4×8/3 = 32/3

y = (32/3)x

y = (32/3)(1⅛)

y = (32/3)(9/8)

y = 3×4 = 12

You sell a smartphone that was originally priced at $600 but is now on sale for 20% off. You give a loyalty customer an additional 10% discount. What is the total percent of discount the customer receives on the purchase?

Answers

Answer:

30% is what was given off the phone

$180 was the deduction price on the phone

Step-by-step explanation:

The price was actually $600

A discount of 20% was given on it

Then late extra 10%

Add of the percentage

20+10=30% off the actual price

30% of $600

30/100*600

18000/100=$180

Answer:

Its 28%

Step-by-step explanation:

I don't know step by step all the others were wrong on here so I picked 28% and it said correct

What subtraction problem has a value of 2/3

Answers

Answer:

You have a full amount of chocolate cake and you eat [tex]\frac{1}{3}[/tex] part of the cake and left the remaining amount for the next day. So, what amount of cake that you left for the next day?

Step-by-step explanation:

We have to make a subtraction problem so, that the answer to the problem is [tex]\frac{2}{3}[/tex].

Now, the problem may be described as follows :

You have a full amount of chocolate cake and you eat [tex]\frac{1}{3}[/tex] part of the cake and left the remaining amount for the next day. So, what amount of cake that you left for the next day?

So, the solution is [tex](1 - \frac{1}{3}) = \frac{2}{3}[/tex] amount of the cake. (Answer)

The sum of 200 and 7 times a number

Answers

Answer: 200+7 * X=

Step-by-step explanation:

Answer:

sum = addition, times = multiplication, a number = a variable (let's say n)

Use this written out problem to write the algebraic expression?

200 + 7n    or   7n +200   (both are the same)

Step-by-step explanation:

Help, explain, then you get brainliest and points.

Answers

The scale will draw UP to a larger dimension.

The width would be 16 and the length would be 24.

When you scale factor. You basically multiply its initial number by the amount of ratio given. Since it said scale factor 4. You multiply the width and length by 4.

What helper fact did you double to solve 8 x 6

Answers

Answer: 48

Step-by-step explanation:

You can either add 8 six times or get a calculator and solve.

One cup equals approximately 236 ml. Approximately how many ml are there in one gallon

Answers

Answer:

Approximately there are 3,785.6 milliliters in one gallon

Step-by-step explanation:

Let's find out how many milliliters are there in one gallon.

1 US Cup = 236.6 ml (actual equivalence)

Let's recall that:

16 US Cups = 1 US Gallon

Therefore,

1 US Gallon = 16 * 236.6 ml

1 US Gallon = 3,785.6 ml

Approximately there are 3,785.6 milliliters in one gallon

how old am I if 20 reduced by two times my age is 16

Answers

Answer:

20-2x=16

Divide all by 2

10-x=8

x=2,

Step-by-step explanation:

When you are born about 75% of your weight is water. If a newborn weighs 8 pounds, how many of
those pounds are water?

Answers

Answer:6

Step-by-step explanation:

If you were to divide 8 by 2 you would get 4 and this makes it easier to get the answer. 75% of 4 is 3 so multiple 3 by 2 to get 6.

the answer would be 6


if you do 8 times 75% you get 6

8x75% or 8x.75

Beth started a workout program. On Monday, she did 15 sit-ups.
On Tuesday, she did 21 sit-ups, and on Wednesday, Beth did
27 sit-ups. Make a conjecture about the number of sit-ups Beth
will do on Friday.

Answers

On Friday, Beth will most likely do 39 sit ups. Every day she is doing an extra 6 sit ups.... Thursday would be 33 sit ups and Friday would be 39 sit ups.

Two students were given the expression shown to simplify. Use the drop-down menus to complete the statements about whether each student's answer is an equivalent expression. Then choose an expression that is equivalent. 6 - (2 - 4x)

Sophia: 6+2+4x
Sophia's expression is incorrect/correct because ______.

Ursula: 6−(−2x)
Ursula's expression is incorrect/correct because _______.

Equivalent Expression
A correct equivalent expression is ______.

Answers

Sophia's expression is incorrect because she did not multiply 2 by -1 correctly.

Ursula's expression is incorrect because she cannot simplify 2-4x.

A correct equivalent expression is 6-2+4x.

What can I say? I got this correct on ttm.

Hope you have a great day~

Other Questions
Which expression is equivalent to 5(8z) What mass of Na2CrO4 is required to precipitate all of the silver ions from 73.6 mL of a 0.150 M solution of AgNO3? Is this equation an infinite solution, no solution, or one solution?? 36-7x=-7(x-5) is A common theme in the Asian culture is the emphasis on harmony and collectivism, as a result, the ________ form of decision making is typically used. A. top-down B. decentralizedC. centralized D. committee E. autocratic In the context of debates over the origins of knowledge, Rene Descartes is to John Locke as ________ is to _______. Do you guys now how to estimate 69.58. Which legal right is not given to people under age 18?A) right to an attorneyB) right to be tried as a juvenile regardless of the crimeC) right to cross examine witnessesD) right to remain silent During the 1990s worker productivity growth spiked as computers and the internet were introduced to many businesses for the first time. How did this affect the natural unemployment rate? Consider the following statement: "I examined the statistics for our basketball teams wins last year and found that, when the third team played more, the winning margin increased. If the coach played the third team more, we would win by a bigger margin." Evaluate this statement. which lands did the french imperialists claim in 1884 Which link is missing from this food chain?O decomposerO herbivoreo producerO consumer Mauricio, a project manager at a reputed firm, has been assigned to handle a new project that the firm has received. This project involves a lot of scheduling that has to be handled by Mauricio. Mauricio estimates that the first module of the project could be completed in as few as 15 days or could take as many as 25 days, but most likely will require 20 days. Determine the expected task duration. which of the following phrases would represent this expression x/3 3)A triangle has all integer side lengths and two of those sides have lengths 9 and 16. Consider the altitudes to the three sides. What is the largest possible value of the ratio of any two of those altitudes Express your answer as a balanced chemical equation. Identify all of the phases in your answer.1. Li(s)+N2(g)Li3N(s)2. TiCl4(l)+H2O(l)TiO2(s)+HCl(aq)3. NH4NO3(s)N2(g)+O2(g)+H2O(g)4. Ca3P2(s)+H2O(l)Ca(OH)2(aq)+PH3(g)5. Al(OH)3(s)+H2SO4(aq)Al2(SO4)3(aq)+H2O(l)6.AgNO3(aq)+Na2SO4(aq)Ag2SO4(s)+NaNO3(aq)7. C2H5NH2(g)+O2(g)CO2(g)+H2O(g)+N2(g) A single penny is 1.52 mm thick. The distance to the next nearest star other than our own (Alpha Centauri) is 4.22 light-years. If it were possible to stack one mole of pennies, how many times would the stack go between the earth and Alpha Centauri? Use the unit factoring method to determine the answer and show your work. You will need to find or look up the appropriate conversion factors to solve the problem. Your answer should be in scientific notation and have the correct number of significant figures in order to get full credit. (Please note that the text editing functions/buttons below for this essay question allows you to show exponents by using the button show as "x2"in the controls. To use it type the number followed by the exponent such as 104, highlight the 4 and hit the x2 button and you will end up with 104 as the result) Janelle ate 82% of the pie. What fraction of the pie remained On a public ballot, a state legislature places a question relating to legalization of marijuana for medicinal use. In addition, the legislature passes a law that bans corporations from advertising in favor of or opposing the ballot question. The basis for this ban is to ensure that corporations do not have too much influence on the voters. Is the ordinance constitutional?a.Yes, because commercial speech has only partial First Amendment protection.b.No, because it concerns a question on a public ballot.c.Yes, because the government is advancing a substantial government interest.d.No, because the ban includes advertising that may not be protected by the First Amendment.e.No, because the government has banned politically oriented commercial speech. Which of the following is true of both starch and cellulose? a. They are both polymers of glucose. b. They are geometric isomers of each other. c. They can both be digested by humans. d. They are both used for energy storage in plants. e. They are both structural components of the plant cell wall. Jennifer has been diagnosed with spinocerebellar degeneration. The first stage of the disease involves tremors and unsteady gate. In the later stages, she will be unable to stand, walk, and will be uncoordinated in her movements. This disease probably affects the __________ part of the brain.a) hippocampusb) amygdalac) cerebellumd) cerebral cortex Steam Workshop Downloader