At the county fair, Carrie and Sam climbed up on the carousel horses. Around and around they went; the horses also bobbed up and down. When they got off of the carousel, Carrie told Sam they had been accelerating during their ride. Sam disagreed; they had been moving at a constant speed. Whose response is fully correct, and why?

Answers

Answer 1
I believe sam's response is correct.
When human is riding a moving target with constant speed over a period of time, we tend to have  a visual acceleration perception due to our optical movement.
This make people such as Carrie believes that the carousel horses are accelerating while it actually stayed at constant pace.
Answer 2

Carrie is correct because acceleration involves a change in direction, not just speed. On the carousel, there is centripetal acceleration due to the constant change in direction of the horses on the carousel.

Carrie's understanding of the situation is fully correct. When they were on the carousel, Carrie and Sam were indeed accelerating despite moving at what seemed to be a constant speed. This is because acceleration is not just a change in speed, but a change in velocity, which includes both speed and direction. In the case of the carousel, although the horses were moving at a constant speed in a circular path, their direction was continually changing, which means they were undergoing centripetal acceleration. The fact that the horses also bobbed up and down adds vertical acceleration to the motion.

Observing other scenarios where objects are in motion, such as on gravity-driven amusement park rides or objects released from moving vehicles, it can be noted that acceleration and perceived motion can vary greatly depending on the observer's frame of reference. For instance, an object dropped by someone who is at rest with respect to the object will observe a different motion compared to someone who is not moving with the object.

In the case of an amusement park ride where a chair is hoisted up at a constant speed, if a rider drops a corndog without giving it any additional speed, it will initially move upwards with the same velocity as the rider, and then slow down due to gravity until it begins to fall towards the ground. The corndog's perceived acceleration from the rider's perspective is negative as it decelerates, but from the ground perspective, the corndog has a positive acceleration downwards (due to gravity) after release.


Related Questions

Calculate the mass of butane needed to produce 96.7 g of carbon dioxide

Answers

31.9 grams butane needed to produce 96.7 grams CO2

Otocz kółkiem symbole pierwiastków chemicznych

Na, H2O, KI, O, S, CO, MgO, Co, Si, Al, Fe2O3

Answers

This particular question is asking for the turker to circle the symbols of the chemical elements. The listed elements to be circled include the various choices: NA, S, O, Co, Si, and Al. The rest of the symbols are not chemical elements.

A certain shade of blue has a frequency of 7.03 × 1014 Hz. What is the energy of exactly one photon of this light?

Answers

4.66 x 10^-19 Joules The energy of a photon is E=hf Where E = Energy h = Planck's constant (6.62607004Ă—10â’34 J s) f = frequency of photon. So plug in the known values E = 6.62607004Ă—10â’34 J s * 7.03 x 10^14 1/s E = 4.65812724x10^-19 J Since we only have 3 significant figures, the rounded result is E = 4.66x10^-19 J

The energy of one photon of light with a frequency of 7.03 × 1014 Hz is approximately 4.65618 × 10-19 Joules. This is obtained using Planck's equation, E = hf, where E is the energy, h is Planck's constant and f is the frequency of the light.

Explanation:

The subject of this question is Physics. The student wants to know the energy of exactly one photon of light that has a frequency of 7.03 × 1014 Hz. We can use Planck's equation which relates the energy of photon, its frequency and Planck's constant (h = 6.626 × 10-34 J.s).

So, the energy (E) of the photon is given by the formula E = hf. Substituting the frequency (f = 7.03 × 1014 Hz) and Planck's constant into the formula gives E = (6.626 × 10-34 J.s)(7.03 × 1014 Hz) which gives approximately 4.65618 × 10-19 Joules. This is the energy of one photon of light with a frequency of 7.03 × 1014 Hz.

Learn more about Photon here:

https://brainly.com/question/34240307

#SPJ12

Draw the structural formula of 4,5-diisopropylnonane.

Answers

Following the IUPAC rules, the longest carbon chain should consist of 9 carbons because of the word 'nonane'. From there, attach two isopropyl (3-carbon chains) to the 4th and 5th carbon starting either from the left or right of the parent carbon chain. The structural formula is shown in the picture attached.
Final answer:

The structural formula of 4,5-diisopropylnonane is CH3-(CH2)3-C(CH3)2-C(CH3)2-(CH2)4-CH3. It represents a nine-carbon alkane with isopropyl groups on the fourth and fifth carbon.

Explanation:

The name 4,5-diisopropylnonane tells us that the compound is a nine-carbon alkane with isopropyl groups on the fourth and fifth carbon. The term 'nonane' represents a chain of nine carbon atoms. An isopropyl group is a carbon group with the formula -CH(CH3)2, which can be represented visually with one carbon connected to a carbon that is also connected to two other carbons with all remaining bonds with hydrogen. The fourth and fifth carbons in the chain of nonane have this type of structure attached. Therefore, the structural formula of 4,5-diisopropylnonane is as follows: CH3-(CH2)3-C(CH3)2-C(CH3)2-(CH2)4-CH3

Learn more about Structural formula of 4,5-diisopropylnonane here:

https://brainly.com/question/5819142

#SPJ3

436 K = °C
163
709
-163
-709

Answers

436 Kelvin = 162.85 Celsius. To convert from Kelvin to Celsius you can use the folowing formula:

[°C] = [K] − 273.15.

Answer : The correct option is, [tex]163^oC[/tex]

Explanation :

The conversion used for the temperature from Kelvin to degree Celsius is:

[tex]K=273+^oC[/tex]

where,

K = temperature in Kelvin = 436 K

[tex]^oC[/tex] = temperature in degree Celsius = ?

Now put the value in the above conversion, we get the temperature in degree Celsius.

[tex]436=273+^oC[/tex]

[tex]^oC=436-273[/tex]

[tex]^oC=163[/tex]

Therefore, the temperature in degree Celsius is, [tex]163^oC[/tex]

if the waste you have contains 100.0 grams of silver nitrate, how many mols of silver nitrate is this

Answers

Final answer:

To find the number of moles of silver nitrate, divide the mass by the molar mass.

Explanation:

To determine the number of moles of silver nitrate in a given mass, we need to use the molar mass of silver nitrate. The molar mass of silver nitrate (AgNO3) is 169.88 g/mol.

Given that the waste contains 100.0 grams of silver nitrate, we divide the mass by the molar mass to find the number of moles:

Number of moles = Mass (g) / Molar mass (g/mol)

Number of moles = 100.0 g / 169.88 g/mol = 0.589 mol

Learn more about moles of silver nitrate here:

https://brainly.com/question/22031122

#SPJ3

1. Given 100.0 grams of silver nitrate, we calculate it to be approximately 0.588 moles of silver nitrate.

2. According to the balanced chemical equation with copper, 0.294 moles of copper are needed to completely react with the silver nitrate. This ensures the reaction proceeds to completion.

To determine the number of moles of silver nitrate (AgNO₃) from the given mass, we use its molar mass:

Determine the molar mass of AgNO₃: 169.88 g/mol.Calculate the moles of silver nitrate:
Moles of AgNO₃ = mass / molar mass = 100.0 g / 169.88 g/mol ≈ 0.588 mol.

Next, we need to determine how many moles of copper (Cu) are needed to react completely with the silver nitrate.

The balanced chemical reaction between these two substances is:

2AgNO₃(aq) + Cu(s) → Cu(NO₃)₂ (aq) + 2Ag(s)

From the balanced equation, we see that 1 mole of Cu reacts with 2 moles of AgNO₃. Therefore, we use the stoichiometric ratio to find the required moles of copper:

Moles of Cu = 0.588 mol AgNO₃ * (1 mole Cu / 2 moles AgNO3) = 0.294 mol Cu

Correct question is: Answer the following :

1. If the waste you have contains 100.0 grams of silver nitrate, how many moles of silver nitrate is this? (Use the molar mass of the silver nitrate from above)
2. If you found that the waste contains 100.0 grams of silver nitrate, how many moles of copper would you need to completely react with all of the silver nitrate?

A metal M is converted to the metal sulfate M2(SO4)3. then a soultion of the metal sulfate was treated with calcium chloride to give calcium sulfate perciptate.If 1.2 g of the metal gave 5.451 g calcium sulfate what is the identity of metal M?
M2(SO4)3(aq)+3CaCl2(aq) ----->
2MCl3(aq)+3CaSO4(s)

Answers

1) From the chemical equation you obtaing the theoretical molar ratios:

2 mol of M : 3 mol of CaSO4

2) Convert 5.451 g of CaSO4 into number of moles

number of moles = mass in grams / molar mass

molar mass 0f CaSO4 = 136.14g/mol

=> number of moles of CaSO4 = 5.451 g / 136.14 g/mol = 0.0400 mol

3) Make a proportion with the unknown, 0.0400 mol and the theoretical molar ratio:

x / 0.0400 mol of CaSO4 = 2 mol of M / 3 mol of CaSO4

=> x = 0.400 * 2 / 3 mol of M = 0.02667 mol of M

4) Use the mass of 1.2 g and the number of moles to obtain the molar mass of M

molar mass = mass in grams / number of moles

=> molar mass = 1.2 g / 0.02667 moles = 45 g/mol

5) Use a periodic table to find the molar masses of different metals.

Scandium atomic mass is 45 g/mol, so the metal is Scandium.

Answer: Scandium
Other Questions
How did the Supreme Court's decision in Schenck v. United States affect free speech? A.It expanded it by saying that burning draft cards was a permitted form of symbolic speech. B.It expanded it by saying that speech intended to cause people to break the law was permitted. C.It limited it by saying that opposition to the draft was a danger to the country during wartime. D.It limited it by saying that people could not dishonor the U.S. flag. The ___________ controls vital functions like breathing, heart rate, digestion, and awake/alert arousal. What were the three main issues that led to the creation of third parties during this antebellum era? explain how the Inca and Aztec empires were impacted by European exploration/colonization Stanley is putting wallpaper strips on his bathroom walls that have a total area of 460 ft2. Each strip of wallpaper covers 22 square feet. How many strips of wallpaper will Stanley need to fully cover his walls? Write your answer using the correct number of significant digits. 16x0 + 2x2 y 1 i need help because i dont know how to do it what was the directional trend in the spread of the Black Death? more south-north, west-south, west-east, north-south or north-west What candidates performance in the first televised debate helped his campaign? The idea of total war existed in all countries involved in World War I. For example, countries used------- to determine how much food, rubber, gasoline, and other items each citizen could use during the war. In order to draft more soldiers into the military, many of the nations established a policy of mandatory------------- . Some countries also controlled public opinion during the war by using --------to prevent discouraging news from reaching the public Which form of the word advertise BEST fits this sentence? After spending a few years as a stock broker, Finn decided to try his hand in the rapidly expanding field of ________________.A)advertisementEliminateB)advertiserC)advertisesD)advertising Which organic compound is correctly matched with the subunit that composes it? Which is more reactive copper or calcium? Why? What is the value of x in the solution to the following system of equations?x 2y = 23x + y = 6 Solve the following and express each answer in scientific notation and to the correct number of significant figures. A). (5.3 x 10^4) + (1.3 x 10^4) B). (7.2 x 10^-4) /(1.8 x 10^3 C). 10^4 x 10^-3 x 10^6 D). (9.12 x 10^-1) - (4.7 x10^-2 E). (5.4 x 10^4) x (3.5 x 10^9) What is the runners average rate of change between the hours: 0.5 and 2? mph 1.5 and 2.5? mph Average Rate of Change The technology needed to create and handle digital signals is more complex than for analog signals. a. True b. False Mexicans can only eat corn tortillas true or false? most plants appear green because chlorophyll Iker siempre ____ su pelo tieso. muestra corta disimula What is the product? Enter your answer as a fraction, in simplified form, in the box. 38(36) Steam Workshop Downloader