What is the common difference in the sequence 5, 10, 15, 20, 25,...?
A. -5
B. 1/2
C. 2
D. 5

Answers

Answer 1
The answer is D

You just need to subtract term 1 (5) from term 2 (10) to find the answer, and the common difference between each sequential term is 5

Related Questions

Vanessa deposited money into a bank account that earned 1.25% simple interest each year. After 1/2 year, she had earned $5.00 in interest on the account. If no other money was deposited into or withdrawn from the account, how much was her initial deposit? Uhh... I was just testing...oops

Answers

so the answer is 800. I guarantee you this will be the answer I promise

Final answer:

Vanessa's initial deposit in the bank, earning 1.25% simple interest per year, was $800. This is calculated using the simple interest formula, rearranged to solve for the principal based on the $5 interest earned in half a year.

Explanation:

To find Vanessa's initial deposit, we use the simple interest formula, which is Interest = Principal × Rate × Time. Given Vanessa earned $5.00 in interest in half a year (0.5 years) at a rate of 1.25% per annum, we can rearrange the formula to solve for the principal (initial deposit).

Using the given information: $5 = Principal × 0.0125 × 0.5, we can solve for the Principal as follows:

$5 = Principal × 0.00625
Principal = $5 ÷ 0.00625
Principal = $800

Therefore, Vanessa's initial deposit was $800.

A triangle has side lengths of 12 cm, 35 cm, and 37 cm. Classify it as acute, obtuse, or right.
acute
obtuse
right

Answers

when you draw triangle
the answer is so easy
it is acute
If a triangle has the side lengths of 12cm, 35cm, and 37cm then the triangle will be acute!

At 9:00 on Saturday morning, two bicyclists heading in opposite directions pass each other on a bicycle path.The bicyclist heading north is riding 4 km/hour faster than the bicyclist heading south. At 10:15, they are 40 km apart. Find the two bicyclists’ rates.

Answers

let x be the speed of bicyclist A (heading north)
     
y be the speed of bicyclist B (heading south)
 
since A is 5km/hr faster than B
 
x = y + 5 -----equation 1

time = 9 to 10:45 = 1.75hours since the distance is 47.25km then,
 
x(1.75) + y(1.75) = 47.25 ---equation 2

substitute equation 1 to 2 (y+5)(1.75) + 1.75y
 
= 47.25 1.75y +8.75 + 1.75y
 
= 47.25 3.5y
 
= 47.25 - 8.75 3.5y

= 38.5

y = 11km/hr
 
substitute to equation 1
 
x = y + 5 x

= 11 + 5 x

= 16km/hr

The speed of Bicyclist A (heading north) is 16 km/h.

The speed of Bicyclist B (heading south) is 11 km/h.

Given:

- Let x be the speed of bicyclist A (heading north).

- Let y be the speed of bicyclist B (heading south).

- Bicyclist A is 5 km/h faster than Bicyclist B, so [tex]\(x = y + 5\)[/tex] (Equation 1).

- Time from 9:00 to 10:45 is 1.75 hours.

- The total distance covered by both bicyclists during this time is 47.25 km.

From the equation for time and distance, we have:

[tex]\[ x \times 1.75 + y \times 1.75 = 47.25 \][/tex]

Substituting Equation 1 into this equation:

[tex]\[ (y + 5) \times 1.75 + y \times 1.75 = 47.25 \]\[ 1.75y + 8.75 + 1.75y = 47.25 \]\[ 3.5y + 8.75 = 47.25 \]\[ 3.5y = 38.5 \]\[ y = \frac{38.5}{3.5} \]\[ y = 11 \text{ km/h} \][/tex]

Substituting the value of y back into Equation 1:

[tex]\[ x = 11 + 5 \]\[ x = 16 \text{ km/h} \][/tex]

Thus, the correct answer is:

- The speed of Bicyclist A (heading north) is 16 km/h.

- The speed of Bicyclist B (heading south) is 11 km/h.

Question :

At 9:00 on Saturday morning, two bicyclists heading in opposite directions pass each other on a bicycle path.The bicyclist heading north is riding 4 km/hour faster than the bicyclist heading south. At 10:15, they are 40 km apart. Find the two bicyclists’ rates.

what does the 2 represent in 12.789

Answers

(Tens digit)(Ones digit) . (tenths digit)(hundredths digit)(thousandths digit)
12.789
2 = (ones digit)

Hope this helps!
It is a whole number in the one digits place
:)

If the sum of a number and 6 is multiplied by 5, the result is same as 9 times the number decreased by 2. find the number.

Answers

Let's do an equation. 5(x+6)=9x-2. Now distribute into parentheses. 5x + 30=9x-2. Now -5x on both sides. New equation is 4x-2=30. Add 2 on both sides. 4x=28. Now divide by 4. X=8. Your number is 8

You invest $2000 in a bank account that has 5% annual interest rate, compound ed continously. how much will you have in 5 years?

Answers

total = $2000(1.05)^5
money = $2552.56

70 is 25% of what number

Answers

I hope this helps you



70=?.25%


70=?.25/100


70=?.1/4


?=280

Find the least residue of 7^5 mod 50 without using a calculator.
so far I have 7=7 mod 50 7^5 = 7^5 mod 50 7^2 = 49 7^3=343 since 7^2=(-1)mod50 and 7^3=(-43)mod50 it follows that 7^6=7^2 * 7^3 = (-1)(-43) = 43 feel like this is wrong though could somebody please explain where I have made an error?

Answers

7^1 = 7 (mod 50)
7^2 = 49 = -1 (mod 50)
7^3 = 7^2*7 = (-1)*7 = -7 (mod 50)
7^4 = (7^2)*(7^2) = (-1)*(-1) = 1 (mod 50)
7^5 = (7^4)*7 = 1*7 = 7 (mod 50)

So 7^5 = 7 (mod 50)

In other words, if we divided 7^5 over 50, the remainder would be 7. We don't need to worry about the quotient. 

Is 89 prime or composite

Answers

it is a prime number. 89=1×89 hope it helps

Answer:

Prime

Step-by-step explanation:

A prime number is a number that has only one factor. A composite number is a number that has more than one factor.

-kiniwih426

logx + log(3x-13) = 1

Answers

x = 5
Condense the left side.
log x(3x-13)=1
Put a base 10 on each side to clear the log.
x(3x-13)=10
3x^2-13x-10=0
Factoring you get x=5 and x=-2/3. The domain for log is x>0 so the -2/3 is an extraneous solution.

The solutions for [tex]\log x + \log (3\cdot x - 13) = 1[/tex] are [tex]x_{1} = 5[/tex] and [tex]x_{2} = -\frac{2}{3}[/tex], respectively.

In this question, we are going to solve for [tex]x[/tex] with the help of Logarithm Properties, which are described in the image attached below.

[tex]\log x + \log (3\cdot x - 13) = 1[/tex]

[tex]\log [x\cdot (3\cdot x - 13)] = 1[/tex]

[tex]\log (3\cdot x^{2}-13\cdot x) = 1[/tex]

[tex]10^{\log(3\cdot x^{2}-13\cdot x)} = 10^{1}[/tex]

[tex]3\cdot x^{2}-13\cdot x = 10[/tex]

[tex]3\cdot x^{2}-13\cdot x -10 = 0[/tex]

This is a Second Order Polynomial, which can be solved by Quadratic Formula:

[tex]x_{1} = 5[/tex] and [tex]x_{2} = -\frac{2}{3}[/tex]

The solutions for [tex]\log x + \log (3\cdot x - 13) = 1[/tex] are [tex]x_{1} = 5[/tex] and [tex]x_{2} = -\frac{2}{3}[/tex], respectively.

Please see this question related to Logarithm Properties for further details:

https://brainly.com/question/12983107

sin10+sin20+sin40+sin50=sin70+sin80.prove it

Answers

We are going to prove it like this:
Lets use the formula sinA+sinB=2sin(A+B/2)cos(A-B/2)
 Now we are going to take the left side of equation
sin10+sin40+sin50+sin20
 Arranging =(sin50+sin10)+(sin40+sin20)
Applying the above formula. =2sin(50+10/2)cos(50-10/2)+2sin(40+20/… =2sin(30)cos(20)+2sin(30)cos(10)
=2sin30{cos20+cos10}
Again using the formula
cosA+cosB= 2cos(A+B/2)cos(A-B/2)
=2sin30{2cos(20+10/2).cos(20-10/2)}
=2sin30{2cos(15).cos(5)}
=2(1/2){2cos15.cos5} as sin30=1/2
=2cos15.cos5
Taking right side of equation sin70+ sin80
Using the formula sinA+sinB
= 2sin(A+B/2)cos(A-B/2)
=2sin(70+80/2)cos(70-80/2)
=2sin75cos5
=2sin(90-15)cos5
=2cos15.cos5 Hope this helps

A basketball team averages 98 points in its first three games.How many points must it score in the next game in order to have 100 point average overall?

Answers

The basketball team must score 106 points in the next game to have a 100-point average overall.

To determine how many points the basketball team must score in the next game to have a 100-point average overall, we need to consider the total points scored in the first three games and the desired average.

The team has already played three games and has an average of 98 points. To find the total points scored in these three games, we multiply the average by the number of games:

Total points in the first three games = 98 points/game * 3 games = 294 points.

To have a 100-point average overall, the team needs to score a total of 100 points per game multiplied by the total number of games played, including the next game.

Let's represent the number of points needed in the next game as "x."

(294 points + x points) / (3 games + 1 game) = 100 points/game.

Simplifying the equation:

(294 + x) / 4 = 100.

Cross-multiplying and solving for "x":

294 + x = 400.

x = 400 - 294.

x = 106.

To learn more about average click on,

https://brainly.com/question/31340101

#SPJ2

A new law requires that 12% of an individual's income be invested in the stock market. Your accounts show that you need to put $420 in the stock market this year. How much did you earn this year.
A $5,040 B $350 C $504** D $3,500

Answers

Final answer:

The problem can be solved by setting up the equation 0.12x = $420, where 'x' stands for your total income. Dividing both sides of the equation by 0.12 gives x = $3500 which is the total annual income. Thus, you earned $3,500 this year.

Explanation:

To solve this mathematical problem, you can set up an equation that represents the problem context. You know that 12% of your whole year's income equals $420. So if 'x' represents your total income, the equation becomes 0.12x = $420. To solve for 'x' (your total income), you would divide both sides of the equation by 0.12.

So, x = $420 ÷ 0.12. When you perform this calculation, you'll find that 'x' equals $3,500. Therefore, you earned $3,500 this year.

The answer to the problem is D. $3,500.

Learn more about Percentage here:

https://brainly.com/question/35647344

#SPJ12

Factor -9x^2-36x-36 please.

Answers

Tricky Trinomial
-9x^2-36x-36
(-9x^2-18x)(-18x-36)
-9x(x+2)-18(x+2)
=(-9x-18)(x+2)
factor out -9
-9(x^2+4x+4)
what 2 numbers multiply to 4 and add to 4
 2 and 2

-9(x+2)(x+2)

What are odd numbers 1-35?

Answers

1,3,5,7,9,11,13,15,17,19,21,23,25,27,29,31,33,35
Is that what you meant.
Odd numbers between 1 and 35 are: 1, 3, 5, 7, 9, 11, 13, 15, 17, 19, 21, 23, 25, 27, 29, 31, 33, 35. So, you count every second number, because the remaining numbers are even numbers.

Which of the following statements is true of chords?

A chord is a line segments.A chord connects two points on a circle.A chord can be a radius of a circle.A chord can be a diameter of a circle.A chord divides a circle into two regions

Answers

All of those are true, except the one about the radius.  Because alternate definition of diameter uses the idea of chord. So, both ends of a chord have to be on the circle, but one end of a radius is at the center, so a radius can't be a chord.

Suppose that a drop of mist is a perfect sphere and that, through condensation, the drop picks up moisture at a rate proportional to its surface area. Show that under these circumstances the drop's radius increases at a constant rate. ...?

Answers

the statement tells you:

dm/dt = k A = 4 pi k r^2 where k is a constant, and r is the radius of the raindrop

use the chain rule to write:

dm/dt = dm/dr x dr/dt

since the raindrop is a sphere (of presumably uniform density), its mass is

m= density x volume = rho x 4 pi r^3/3 where rho is the density of water

so, we have that dm/dr = 4 rho pi r^2, subbing this back we get

dm/dt = 4 pi k r^2 = 4 rho pi r^2 dr/dt

the r^2 on both sides cancel, leaving dr/dt, the rate at which the radius increases, to be constant

From the given condition, the rate of change of radius is constant.

What is rate of change?

How quickly something evolves over time is referred to as its rate of change (ROC).

Given:

Suppose that a drop of mist is a perfect sphere and that, through condensation, the drop picks up moisture at a rate proportional to its surface area.

Let V be the volume of the sphere & S be the surface area.

According to the question,

dV/dt = kS

Since,

V = 4/3πr³

dV/dt = 4πr²dr/dt

S = 4πr²

Putting these values to the above expression,

4πr²dr/dt = k4πr²

dr/dt = k

Therefore, the rate of change of radius is constant.

To learn more about the rate of change;

https://brainly.com/question/29518179

#SPJ2

HELP!!

Lily just paid off a $400 loan. She had to pay $60 in interest at a simple annual interest rate of 5%. How many years did Lily have this loan?

A. 2
B. 3
C. 4.5
D. 5

Answers

I=prt,,60=400*0.05t,,t=3 ..................

Answer:  The correct option is (B) 3.

Step-by-step explanation:  Given that Lily  just paid off a $400 loan. She had to pay $60 in interest at a simple annual interest rate of 5%.

We are to find the number of years for which Lily had this loan.

Let n be the required number of years.

Also, P = $400, S.I. = $60 and r% = 5%.

Therefore, by the formula of simple interest, we have

[tex]S.I.=\dfrac{Prn}{100}\\\\\\\Rightarrow 60=\dfrac{400\times5\times n}{100}\\\\\\\Rightarrow n=\dfrac{60}{20}\\\\\\\Rightarrow n=3.[/tex]

Thus, the required number of years is 3.

Option (B) is CORRECT.

Determine if the equations are intersecting, parallel, or coincident. bx - ay = 2 ax + by = 3

Answers

The equations are parallel because the slopes of the two lines are equal. 
The equations are parallel

Answer:

Intersecting

Step-by-step explanation:

After having singled out y on one side of both equations you should have.

Y=b/a• x - 2/-a

And

Y= -a/b • x + 3/b

As you can see they have opposite reciprocals which is an intersection

mr. and mrs. boyce bought a house for 96000 in 1995. real estate values in their area increase approximately 4% each year. what was the value of the house in 2007?

Answers

Use this formula:
[tex]P(t) = P_0 (1 + r)^t[/tex]
[tex]P(12 years) = (96000) \cdot (1.04)^{12}[/tex]
[tex]P(12) = 153699[/tex]
Final answer:

The Boyce's house bought for $96,000 in 1995, increased approximately 4% yearly. By applying the compound interest formula, the house's value in 2007 would be approximately $139,254.09.

Explanation:

We need to use the compound interest formula to calculate the value of Boyce's house in 2007 because the house price increase is compounded annually. The formula is P(1 + r/n)^(nt). Here, P is the initial amount (i.e., the original house price), r is the annual interest rate (the rate of increase in house value), and n is the number of times interest is compounded yearly. T is the number of years the money is invested.

However, as we deal with annual compounding, the formula simplifies to P(1 + r)^t. In this case, P = $96,000, r = 4% or 0.04, and t = 2007 -1995 = 12 years.

Inserting these values, we get 96000(1 + 0.04)^12 = $139,254.09 (rounded to the nearest cent).

So, according to the 4% annual increase rate, Boyce's house would be worth approximately $139,254.09 in 2007.

Learn more about Compound Interest here:

https://brainly.com/question/14295570

#SPJ2

Which fraction shows a correct way to set up the slope formula for the line that passes through the points (3,7) and (5,7)?

Answers

The slope of a line through the points (3,7) and (5,7) is 0, indicating a horizontal line.

To calculate the slope of a line passing through two points, you can use the formula m = (y2 - y1) / (x2 - x1), where (x1, y1) and (x2, y2) are the coordinates of the two points. In this case, the points are (3,7) and (5,7). Using the slope formula, we get:

m = (7 - 7) / (5 - 3) = 0 / 2 = 0

So, the slope of the line that passes through these points is 0, which means the line is horizontal.

Eric reflected parallelogram ABCD across the x-axis. If angle A is 125° and angle B is 55°, what is the degree measurement of angle A'?

Answers

the answer simple;
the degree measurement of angle A' = 125°



Answer:

Angle A= Angle A' = 125°

Step-by-step explanation:

We have given that : Eric reflected parallelogram ABCD across the x-axis.

                                  If angle A is 125° and angle B is 55°

To find :  Degree measurement of angle A'

Solution :

As it is reflected parallelogram , and by property of reflection it form congruent parallelogram

since it is congruent then measures of angle remain same

by this statement the measure of angle of parallelogram ABCD

remain same or equal to parallelogram A'B'C'D'

⇒Angle A= angle A' = 125°

{-4y-11x=36
{20=-10x-10y

Answers

Solve this by method of elimination where you make one term equal and then cancel it out.

36=-4y-11x  (Equation 1)
20=-10x-10y (Equation 2)

Reorganize the terms.
36=-11x-4y (Equation 1)
20=-10x-10y (Equation 2)

Multiply Equation 1 by 5 and Equation 2 by 2 to make y equal.
180=-55x-20y
40=-20x-20y

Now subtract Equation 2 from Equation 1. It is a bit messy but it looks like:
180-40=-55x-(-20x)-20y-(-20y)
180-40=-55+20x-20y+20y
140=-35x

We have now removed y from the equation, so we can now solve for x. Divide each side by -35 to find x.

140=-35x
-4=x

We have the equation 20=-10x-10y. Substitute -4 for x to solve for y.

20=-10x-10y
20=-10(-4)-10y
20=40-10y
-20=-10y
2=y

x=-4
y=2

Which of the binomial is a factor of this trinomial x2-7x-44?

Answers

I hope this helps you



x^2-7x-44

x -11



x +4



(x-11)(x+4)

Simplify each given equation and show your work. Tell whether it has one solution, an infinite number of solutions, or no solutions, and identify each equation as an identity, a contradiction, or neither. Explain your answers.
(a)6x + 2(2x – 3) = 24 + 9x
(b)25 – 4x = 3(5 – x) + 10 – x
(c)4(x + 2) = 2x + 7 + 2(x – 10)

Answers

a) The answer is one solution, neither

6x + 2(2x - 3) = 24 + 9x
6x + 2 * 2x + 2 * (-3) = 24 + 9x
6x + 4x - 6 = 24 + 9x
10x - 6 = 24 + 9x
10x - 9x = 24 + 6
x = 30

b) The answer is infinity solutions, identity
25 – 4x = 3(5 – x) + 10 – x
25 - 4x = 3 * 5 - 3 * x + 10 - x
25 - 4x = 15 - 3x + 10 - x
25 - 4x = 25 - 4x
4x - 4x = 25 - 25
0x = 0

x can be any number, so an infinite number of solution

c) The answer is no solution, contradiction

4(x + 2) = 2x + 7 + 2(x – 10)
4 * x + 4 * 2 = 2x + 7 + 2 * x - 2 * 10
4x + 8 = 2x + 7 + 2x - 20
4x + 8 = 4x - 13
4x - 4x = - 8 - 13
0 = -13

this is contradiction

What is the solution to the following bernoulli de?
\[t^2 dy/dx+y^2=ty\]

Answers

So, from your equation t^2 dy/dx+y^2=ty

Dividing boths side by t^2 we get
dy/dx+y^2/t^2=y/t
After re arranging 

dy/dx−y/t=−y^2/t^2

after substituting we get
w=−y^−3

What is the surface area of this design

Answers

6 × 8^2 = 384.
hope it helps

Answer:

[tex]384\ in^{2} \\[/tex]

Step-by-step explanation:

Hello

according to the graph the figure is a cube, which has 6 square faces of 8 inches each side,the total area will be equal to the area of ​​one of these faces multiplied by 6

Area of a square=side* side

Area of square= 8 in * 8 in

[tex]Area = 64\ in^{2}  \\[/tex]

Now, the total area is

[tex]Tarea=6*64\ in^{2} \\Tarea=384\ in^{2}[/tex]

1 in= 1 inch = 2.54 cm

have a fantastic day

A square sheet of art paper has an area of 625 square inches. what is the minimum side length of an easel that supports the whole sheet of paper?
a.-25
b.25
c.15
d.35(-25 or 25?)

Answers

the of the question the letter B

There are 132 people seated in the school auditorium for an assembly.  There are 6 rows in the auditorium, each with the same number of seats.  If the auditorium is completely filled, how many seats are there in each row?

Answers

You do 132 ÷ 6 which is 22, so that is the answer. This is because if you the auditorium is filled, then there are a total of 132 seats. If there are 6 rows, then there have to be 22 seats each row to make 132 seats. I hope this helps!
The answer is 22 seats in each row.

Explanation:
132÷6=22

Hope it helps!

Tyrone’s hourly wage is $18 and his net pay is 72% of his earnings. Tyrone spends about $1,800 on his monthly expenses. If Tyrone works 40 hours per week and has no other sources of income, what is his total monthly cash inflow? (Hint: Assume that there are 4 pay periods per month.)

Answers

$2073.60 per month

===================

To calculate Tyrone's total monthly cash inflow, we need to determine his weekly and then monthly earnings.

Calculate weekly gross income:

$18/hour * 40 hours/week = $720/week

Calculate net pay per week:

$720/week * 72% = $518.40/week

Calculate monthly cash inflow:

$518.40/week * 4 weeks/month = $2073.60/month

Tyrone's total monthly cash inflow is $2073.60.

Other Questions
what two different multiplication problems have a product of 2.352 which set of values could be the side lengths of a 30-60-90 triangle?A. {4,4/3,8/3}B. {4,4/3,8}C. {4,4/2,8}D. {4,4/2,8/2} Identify the subject take the elevator to the third floor and walk to room 104 Which is an example of a folkway? A.The Spectors obey the speed limit when they drive in the city because they do not want to receive a traffic ticket. B.The Thorns named their son Jeremiah after Ms. Thorn's father because it is their tradition to name their children after family members. C.The Antouns painted their house white because the city requires all houses to be painted white. D.The Ryersons cut their lawn during the week because of a law that prohibits loud noises on the weekends. The water cycle is also known as Which state did not attend the constitutional convention which meet at independence hall in philadelphia? There were four returns from exile.TrueFalse Which of the following is an example of why irrational numbers are 'not' closed under addition?4 + 4 = 2 + 2 = 4, and 4 is not irrantonal1/2 + 1/2 = 1, and 1 is not irrational10 + (-10) = 0, and 0 is not irrational-3 + 3 = 0, and 0 is not irrational WILL UPVOTE!Question 5 (Multiple Choice)Paul's doctor says his cardiorespiratory fitness level is excellent, but she worries about Paul's muscular fitness. Paul enjoys gymnastics, baseball, biking, and yoga. Increasing the frequency of which activity will best improve Paul's muscular fitness?A) GymnasticsB) BaseballC) BikingD) Yoga Fill in each blank with the vocab work in 7 questions.1) Walter Mitty was so _______ that he couldn't buy puppy biscuits without consulting his wife.2) Although they were not wealthy, her parents left her a rich _________ by giving her a fine education.3) Showing us photographs from her childhood, Grandmother pointed out the distinctive _______ resemblance among her cousins.4) After Uncle Nick died, I realized how much I depended on his _________ affection.5) In the movie, the deceitful ________ maintained a wife, two children, and a dog in two different cities. friendly riddle:What is greater than God,more evil than the devil,the poor have it,the rich need it,and if you eat it, you'll die? According to the essay "Lifeboat Ethics," programs designed to help poor nations grow more food are known as what? A.The Lifeboat Group B.The Green Revolution C.Food for Folks D.Feed the World In the united states, a recent trend involving parenting is that a. women are having more children. b. women are marrying earlier in life. c. more adu Ana, conoces a la maestra de historia? S, yo ____ _________. In order to determine the power, you must know..a. current and voltageb. force and accelerationc. newtons and joulesd. resistance and amperage An object is seen to either speed up, slow down, or change direction. These behaviors are caused by Blank Space __________.Question 4 options:a balanced set of forcesstable factorsunbalanced forcesfrictional force You are remodeling your kitchen. You've contacted two tiling companies who gladly told you how long it took their workers to tile a floor of a similar size. Jim completed half the floor in 7 hours. Pete completed the other half of the floor in 6 hours. If Pete can lay 15 more tiles per hour than Jim, what equation would you use to find the rate that Jim can lay tiles? Let x represent Jim's rate.explain why the answer is correct What is the number of possible outcomes if three quarters are tossed and the total numbers of heads and tails are counted? What is the distance between -3.1 and -5.7 on a number line? A car travels 20 km west, then 20 km south. what is the magnitude of its displacement?A) 0 kmB) 20 kmC) 28 kmD) 40 km Steam Workshop Downloader