What would most likely happen if green plants were exposed to longer days of sunlight?
A. The mitochondria would produce less energy .
B. The chloroplasts would produce more energy.
C. The cell wall would become thicker.
D. The vacuoles would quickly shrink.
Answer: B. The chloroplasts would produce more energy.

Answers

Answer 1
The answer is B because the chloroplasts would produce more energy

Related Questions

A food web in a rain forest is shown below. Which of the following most likely occupies the location marked X in this food web?
A. decomposers
B. primary consumers
C. producers
D. secondary consumers
E. abiotic factors

Answers

I think the answer would be decomposers

What is the most likely explanation for how speciation occurs

Answers

Answer:

when populations of a species that share the same habitat become reproductively isolated from each other.

Explanation:

Answer:

Natural selection is one explanation how speciation occurs.

Explanation:

Natural selection is a key mechanism of evolution, in which survival and reproduction differences affects the evolution process.

It's important to say that Natural Selection is related with only phenotype's act, because it's due to environmental changes, adapting to those variables in order to survive.

What is the typical source of well water?
A. A holding tank
B. A discharge zone
C. A geyser
D. An aquifer

Answers

Answer:

an aquifer

Explanation:

An aquifer is the typical source of well water


Select the words that correctly complete the statement.
_____ is an example of optimal health. To gain optimal health, the first step is to ______
1 ) the absence of disease
1) a high protein diet
1) sufficient sleep
1) taking a variety of vitamins and mineral supplements
1) the perfect body

2) eat healthy
2) establish practical goals
2) establish priorities
2) establish realistic goals
2) improve intellectual health

Answers

The absence of disease is an example of optimal health. To gain optimal health, the first step is to eat healthy.

According to the question;

We are required to select the words that correctly complete the statement.

For the first blank space;

A very good indicator of optimal health is; The absence of disease.

For the second blank space:

To gain optimal health, it is pertinent that one eats healthy.

Read more:

https://brainly.com/question/20519649

This is the amino acid cysteine. Circle the amine group, put a box around
the carboxylic acid group and use a different colored pencil/pen to circle the side
chain (R group).


H O
| ||
NH2— C- C-OH
|
CH2
|
SH​

Answers

I attached the pic. NH2 is amine group, COOH is carboxyl group.
Final answer:

The amine group in cysteine is NH₂ found on the left side of the molecule. The carboxylic acid group is COOH found on the right side of the molecule. The R group or side chain in cysteine is CH₂-SH.

Explanation:

The amine group in an amino acid is the part of the molecule that contains nitrogen (NH₂). In the case of cysteine, this would be on the left side of the molecule. You can circle this part. The carboxylic acid group is the part of the molecule that contains a carbon atom double-bonded to an oxygen atom and also bonded to a hydroxyl group (C-OH). In cysteine, this would be towards the right side of the central carbon. You can put a box around this. The R group, or side chain, is different for each different amino acid. For cysteine, this is composed of a carbon atom bonded to a sulfhydryl group (CH₂-SH). You can use a different color to circle this part.

Learn more about Amino acid groups here:

https://brainly.com/question/33427968

#SPJ2

Genes that come together with different alleles are called______.
heterozygous.
homozygous.
genotype.
segregated.

Answers

Answer:

Genes that come together with different alleles are called heterozygous. ( first choice)

The correct answer is heterozygous

An organism’s allele combination is called the​

Answers

Answer:genotype

Explanation:

Answer:

Genotype

Explanation:

Got it correct on ck12

Which organelles are found only in plant cells?

Answers

chloroplasts- contains chlorophyll for photosynthesis
permanent vacuole
cell wall

Answer:

c) cell wall , vacuole

Explanation:

ext ©
Introduction to Biology: Mastery Test
How is a scientific law different from a scientific theory?
OA.
A theory becomes a law after a long period of time has passed.
OB.
A theory is used for biology and chemistry and a law is used for physics.
HEEGES
U
C.
A theory is why something happens and a law is how something happens.
Co
Island
SA
BO
D.
A theory cannot be disproved but a law can be disproved.
nit
ES​

Answers

Final answer:

A scientific law describes a generalized pattern in nature and is often expressed as a mathematical equation, while a scientific theory provides a comprehensive explanation for a group of related phenomena. Scientific laws describe what happens, and theories explain why and how it happens.

Explanation:

The difference between a scientific law and a scientific theory is a fundamental aspect of scientific knowledge. A scientific law uses concise language to describe a generalized pattern in nature that is supported by scientific evidence and repeated experiments, often expressed in the form of a mathematical equation. In contrast, a scientific theory is a well-supported explanation of observations; it is more complex and dynamic, explaining a group of related phenomena rather than describing a single action. For instance, Newton's second law of motion, which can be summarized by the equation F = ma, is an example of a scientific law, while the Theory of Evolution is an example of a scientific theory.

Therefore, option C, stating that a theory is why something happens and a law is how something happens, accurately reflects the difference between a scientific law and a scientific theory. Scientific laws describe what happens under certain conditions in nature, often mathematically, while theories provide the explanation behind these observations, elaborating on why and how the phenomena occur.

When listing the levels of organization in organisms from smallest to most complex, which level is just below organs in
complexity?

Answers

When listing the levels of organization in organisms from smallest to most complex, which level is just below organs in
complexity?

Answer:

tissues

Explanation:

I hope this helps you.

which is an example of a decomposer?
A. Bear
B.Algae
C.Grass
D.Bacteria
Answer: D Bacteria

Answers

Answer:

D.Bacteria

Explanation:

A & B are primary producers

D is a secondary consumer

The answer is D. Bacteria.

Bacteria breaks down dead organisms, keeping our planet from being buried in dead organisms. Thus, bacteria bear and important task in being a decomposer.

Hope this helps!

Which is a function of nucleic acids​

Answers

Answer:

Nucleic acids are important because they make up genetic information in living things. There are two types of nucleic acid and they are DNA and RNA. DNA is the basic instructions for living things. It is passed down from parent to offspring and is found in the nucleus of the cell.

Explanation:

Answer:

store genetic information

Explanation:

explain the concept of conservation of natural resources

Answers

Answer:

The Earth's natural resources include air, water, soil, minerals, fuels, plants, and animals. Conservation is the practice of caring for these resources so all living things can benefit from them now and in the future.

Answer:

he or she is right

Explanation:

Which step of the scientific method relies more heavily on newly collected data than on creativity and innovation?
drawing a conclusion
designing an experiment
solving a problem
formulating a question

Answers

Answer: drawing a conclusion

Answer:

The best possible answer is: Drawing a conclusion.

Explanation:

in orde to write a conclusion report on an experiment you need the data collected from the experiment. Designing the experiment requires too much trial and error. formulating the question is purely a made up idea until tested. However, solving a problem depends on wether it is after the experiment or during. If it is after than you are most likely using information from the experiment, in this case it could be the right answser. If it is during then the it is about what you can do to fix something that went wrong in the experiment. I hope this helps you!

Name any 3 methods of irrigation and briefly describe them.

Answers

3 methods of irrigation are drip, surface, and sprinkler. Sprinkler irrigation applies water to soil, surface irrigation transports it to the channels where it floods the field, and drip irrigation exposes the roots to more supplies of water.

Nutrients can also be provided through irrigation to the crops. The different sources of water for irrigation are wells, lakes, ponds, canals, tubewells and even dams.

What is irrigation?

Irrigation is defined as the process of applying water to the crops artificially to realize their water requirements.

The three important methods of irrigation are sprinkler, surface, and drip/micro.

Water flows over the soil by gravitation force for surface irrigation. Sprinkler irrigation, also known as spray irrigation, is a means of dispensing water in a regulated manner, comparable to rainfall. Pumps, valves, pipes, and sprinklers may be used to disperse the water. Irrigation sprinklers can be used in a variety of settings, including residential, industrial, and agricultural.Drip irrigation entails laying tubing with emitters next to the plants on the ground. The emitters trickle water into the root zone of the soil slowly. Plant production and quality improve as moisture levels are maintained at an appropriate level.

For more information regarding irrigation, visit:

https://brainly.com/question/903241

#SPJ2

What causes upwelling?

Answers

Explanation:

Upwelling is a oceanographic phenomenon. It is a process which results in the replacement of warm and nutrient less water with the cold and nutrient enriched water at the surface of oceans, seas, etc. As a result of this process, the surface water rises. The phenomenon behind this process is that the high intensity winds move the cold water from the middle of the ocean or sea towards the surface of the ocean or sea replacing the warm water which was present there. Due to this process, the nutrient enriched water reaches the surface of the oceans and seas.  

(Wind) should be your answer

(APEX)

Question 8 (5 points)
Radioactive elements comprise a majority of the____
actinides
halogens
lanthanides
noble gases

Answers

Radioactive elements comprise a majority of the "ACTINIDES"

These are elements in the bottom row of the periodic table.

Answer: Option A. actinides

Explanation:

Radioactive element is an element whose nucleus  degenerate spontaneously due to the emission of alpha and beta particles, or gamma rays.

Radioactive elements are majorly comprise of Actinides.

Actinides also called actinoids, all are radioactive elements and release energy on radioactive decay. Uranium and thorium are naturally occurring whereas plutonium  are synthetic actinides which are most abundant actinides on Earth.

Hence, the correct option is A.

what effects would el nino most likely have on organisms?

Answers

El Niño would lead to the death of organisms or populations, El Niño would cause organisms to move in search of food and better conditions.

Hello. This question is incomplete. The full question is:

"What effects would el niño most likely have on organisms? check all that apply :

el niño would lead to the extinction of a species.  el niño would lead to the death of organisms or populations.  el niño would cause changes in the genetic makeup of organisms,  el niño would cause continents to move to different parts of the planet.  el niño would cause organisms to move in search of food and better conditions."

Answer:

El Niño would lead to the death of organisms or populations. El Niño would cause organisms to move in search of food and better conditions.

Explanation:

El Niño is a climatic phenomenon that has many effects on nature. Basically, this phenomenon is characterized by the promotion of trade bliss from the east towards the west. When this occurs, the result is an accumulation of hot water in the upper layer of the Pacific oceans. With the increase in water temperature, evaporation becomes much higher than normal, forming large clouds laden with water vapor in this region, which will result in a strong rainy season.

El niño can affect the fauna of this region in a great way, some examples that can happen are:

El Niño would lead to the death of organisms or populations. El Niño would cause organisms to move in search of food and better conditions.

Halogens are destructive to ozone because they are highly reactive with oxygen. Please select the best answer from the choices provided T F

Answers

Answer:

True

Explanation:

Halogens belongs to the seventh group on the periodic table. This group contains the most reactive set of elements that we have. They require just an electron to achieve a noble and stable electronic configuration.

When halogens mostly in form of ChloroFluoroCarbons(CFCs) reaches the atmoshpere, ultraviolet rays release chlorine atoms which easily breaks away an oxygen atom from ozone. Ozone thereby turns into an oxygen gas with two oxygen atoms instead of three. This reaction depletes the ozone layer.

The Correct Answer Is: TRUE (Just Took The Test)

Match the following. 1. the process involving the division of the nucleus in a reproductive cell; responsible for genetic recombination meiosis 2. the process involving the division of the nucleus of a body cell ovum 3. the condition of having oogametes—gametes of different sizes and shapes; usually have eggs and sperm sexual reproduction 4. (pl. ova) the egg cell; a female gamete oogamy 5. the form of production of new individuals by two parents in which the offspring obtains half of its hereditary information from each parent mitosis 6. a small, flagellated male gamete that swims to the egg to fertilize it sperm

Answers

Answer:

1. Meiosis: The process involving the division of the nucleus in a reproductive cell...

2. Mitosis: the process involving the division of the nucleus of a body cell

3. Oogamy: the condition of having oogametes...

4. Ovum: the egg cell...

5. Sexual Reproduction: the form of production of new individuals by two parents....

6. Sperm: a small flagellated male gamete...

Explanation:

1. Meiosis is a type of cell division that produces gametes, or reproductive cells. The process produces haploids, which have half the number of chromosomes as the parent. Genetic recombination occurs in meiosis, where there is an exchange of genetic information between the chromosomes, which bring about genetic diversity.

2. Mitosis is also a type of cell division, but unlike in meiosis, they produce clones of the parent cell. They produce diploids and this occurs in body cells. The purpose of mitosis is for growth, repair and asexual reproduction.

3. Oogamy is a form of sexual reproduction. What you would observe with oogamy is that one sex cell or "gamete" is bigger than the other gamete and the bigger gamete is non-motile or it can't move, while the other can. The egg cell for example is larger than the sperm cell, but it cannot move, while the sperm cell can.

4. The female gamete is called the ovum, plural form would be ova. This is also known as the egg cell. It is non-motile, so that means it cannot move. It's main purpose is to be fertilized by the sperm cell.  

5. Sexual reproduction is the fusion of two gametes, which produces a fertilized egg, or a zygote. These gametes are haploid cells, which are produced in meiosis, and they each have half the genetic information of their parent cell. Thus the offspring produced will be genetically different from their parents.

6. The sperm cell is the male gamete. It has a flagella, which is like a tail that helps it move.  It's main purpose is to fertilize an egg cell.

1.Meiosis

2.Mitosis

3.Oogamy

4.Ovum

5.Sexual Repoduction

6.Sperm

11. What's a recharge area?
A. The part of an aquifer where groundwater meets a lake or stream
B. The part of an aquifer where surface water reaches the water table
C. The part of an aquifer that's located between two aquicludes
D. The part of an aquifer that's located at a lower elevation

Answers

Answer:

B. The part of an aquifer where surface water reaches the water table

Explanation:

The recharge area of an aquifer, is the area where the aquifer comes in touch with the surface water. At this area, the aquifer is receiving new and fresh water reserves from the surface, thus replenishing the water that it has lost.  Most of this water comes from the rainfall and runoff, though rivers and streams can also contribute to it. The recharging of the aquifer is crucial for its existence, as it constantly loses water, and the recharging in giving back water to it, thus balancing the lost and gained water in it.

Answer:

B

Explanation:

Give examples of selective advantage of organism’s body part/organ

Answers

Answer:

The characteristic of an organism that enables it to survive and reproduce better than other organisms in a population in a given environment; the basis for evolution by natural selection.

Explanation:

Match the following items
1. Rr
2. rr
3. Identical alleles
4. Unlike alleles
5. RR
()homozygous, recessive
()homozygous definition
()heterozygous, dominant cell
()heterozygous definition
() homozygous, dominant cell

Answers

Answer:

2. homozygous, recessive

3. homozygous definition

1. heterozygous, dominant cell  

4. heterozygous definition  

5. homozygous, dominant cell

Explanation:

Which part of a cell carries the genetic material? Cell membrane Cell wall Chloroplast Nucleus

Answers

Answer:

nucleus carries the genetic material

nucleus. contains DNA.

where do the respiratory and circulatory systems meet?

Answers

Answer:

B

Explanation:

New generations are better suited to their environment than the first generation. What is this called?

Answers

Answer:

Descent with modification

Explanation:

We define evolution as descent with modification from a common ancestor.

Evolution only occurs when there is a change in gene frequency within a population over time. These genetic differences are hereditary and can be passed on to the next generation - which is what really matters in evolution: long-term change. In this process, the new generations are better suited to their environment than the first generation because of descent with genetic modification.

Final answer:

New generations are better suited to their environment than the first generation due to evolution by natural selection. Individuals with advantageous traits tend to survive, reproduce, and pass these traits to their offspring, leading to better adapted future generations.

Explanation:

The phenomenon where new generations are better suited to their environment than the first generation is known as evolution by natural selection. This process occurs because the members of a population have genetic variability, which results in some individuals having traits that give them a biological advantage in specific environmental conditions. These individuals are more likely to survive and reproduce, passing on these advantageous traits to their offspring. Over time, these traits become more common within the population, making future generations progressively better adapted to their environment.

which of the following is the most likely outcome of global warming

Answers

Answer:

Ongoing effects include rising sea levels due to thermal expansion and melting of glaciers and ice sheets, and warming of the ocean surface, leading to increased temperature stratification. Other possible effects include large-scale changes in ocean circulation.

Explanation:

When a human or animal consumes food, the carbon in that food is most likely to be converted into which of the following elements?

a. carbon remains carbon

b. nitrogen

c. oxygen

d. hydrogen

Answers

Answer:

The answer is A

Answer:

a. Carbon remains carbon

Explanation:

Waianapanapa Beach in Hawaii is a black-sand beach that was formed by
waves crashing against volcanic rock. The sand can be very hot on sunny
days. Which statement best explains why?
O
A. The black sand has no heat capacity.
B. The black sand absorbs no radiation.
O
C. The black sand is immune to insolation.
D. The black sand has a low albedo.

Answers

Answer:

The black sand has a low albedo.- D.

Answer:

d

Explanation:

good luck

What might geneticists learn about genes by studying rna.

Answers

by studying RNA, geneticists could learn about where genes begin and end on a chromosome. they could also learn about where genes are active in different types of the cells.

Final answer:

By studying RNA, geneticists can learn about gene expression patterns, how changes in RNA can affect these patterns, and gain insights into the complex genetic code that defines each protein sequence. RNA's roles in transcribing DNA and translating it into proteins are also significant areas of understanding.

Explanation:

Geneticists can gain a wealth of knowledge about genes by studying RNA, particularly regarding gene expression. RNA stands for ribonucleic acid, a molecule that plays a crucial role in the process of transcribing the genetic instructions inscribed on DNA and translating them into proteins. Each protein sequence is determined by a three-nucleotide sequence in RNA called the triplet codon, effectively forming a genetic code.

By studying RNA, geneticists can discern patterns in gene expression and even predict how changes in specific DNA or RNA sequences could potentially alter this expression. For instance, the Human Immunodeficiency Virus (HIV) is an RNA virus that uses its RNA as a template to create DNA, demonstrating a deviation from the standard genetic flow of information. This highlights the importance of RNA in the realm of genetics and why its study is so vital to understanding the complex interplay of genetic expressions in living organisms.

Learn more about RNA here:

https://brainly.com/question/25979866

#SPJ3

Other Questions
What are the solutions of x2=-7x-8 What effect did the defeat of the boxer rebellion have on China which nation's name means the land of the pure? Which of the following mental illness does NOT begin during adolescence?A. post-traumatic stress disorderB.obsessive-compulsive disorder.C.schizophrenia.D.addictions what is the sum of the measures of the interior angles of this polygon? Which graphs show a proportional relationship?Graph 1Graph 2 Why did England's citizens restore the monarchy after the rule of Oliver Cromwell? Which is the best source of historical evidence to learn about how an event unfolded according to Aristotle, thought is the What did Hitler mean by this statement?o Germany was no longer losing the war.O The Allied Powers had finally lost the war.O Germany was no longer winning the war.O The Allied Powers had finally won the war. Fission of uranium-235 products energy and ______A. isotopes of smaller elements B. isotopes of larger elements C. lighter isotopes of uranium D. heavier isotopes of uranium Suppose that the number of calls coming per minute into an airline reservation center follows a Poisson distribution. Assume that the mean is 3 calls per minute. The probability that at least two calls are received in a given two-minute period is _______. The graph shows how much money the South Dakota livestock industry earns annually. According to the graph, which industry would experience the greatest financial impact from a loss of pastureland Select the verb form that best completes this sentence.Il faut que vous ____________ prudemment votre argent.A.dpensezB.dpensentC.dpensiezD.dpenser What is the length of side BC Fabian mixes orange juice with 4 cans of pineapple juice to make punch. Each can of pineapple juice holds 2 liters. He makes a total of 19 liters of punch. How many liters of orange juice did Fabian use to make the punch? A. 9 L B. 11 L C. 13 L D. 15 L Help!Which of these is the best deal? [Note: there are two pints in a quart, and four quarts in a gallon]Question 6 options:A) one quart of milk for $1B) 1 gallon of milk for $2C) two quarts of milk for $1.50D) One pint of milk for 50 cents 100 Points! Please answer!? Lisa dined at a restaurant and gave the waiter a 15% tip if the price of her meal was $10.25 how much did Lisa tip the waiter negative 55 plus neagtive 7 times 6 subtract negative 3 times 4 Steam Workshop Downloader