Which expression is equivalent to 10k+17–7j-18-11k

A. -8jk-1
B. -7j-k-1
C. -7j+k+1
D. -8j-k

Answers

Answer 1

Answer:

B

Step-by-step explanation:

An equivalent expression is an expression which is equal to 10k + 17 - 7j - 18 - 11k. You can expand or simplify an expression to make an equivalent expression. Combine like terms to form a new equivalent expression. Like terms are terms which have the same base or variable.

10k + 17 - 7j - 18 - 11k

10k -11k + 17 - 18 - 7j                Move to group like terms together.

-k - 1 - 7j

This is the same solution as B written in a different order.

Answer 2

Answer:

BBBBBBBBBBBBBBBBBBBBBBB

Step-by-step explanation:)


Related Questions

WILL GIVE BRAINLIEST! PLEASE HELP!


What is measure of angle R?

Enter your answer as a decimal in the box. Round only your final answer to the nearest hundredth.

Answers

Answer:

[tex] R = 28.07^\circ [/tex]

Step-by-step explanation:

Since you have the lengths of all the sides, you can use sine, cosine, or tangent to find the answer. Let's use the tangent ratio.

For angle R, PQ is the opposite leg, and QR is the adjacent leg.

[tex] \tan R = \dfrac{opp}{adj} [/tex]

[tex] \tan R = \dfrac{8}{15} [/tex]

[tex] R = \tan^{-1} \dfrac{8}{15} [/tex]

[tex] R = 28.07^\circ [/tex]

Answer:

were are the answer selection

Step-by-step explanation:

At t=0, a rock is dropped from rest from the top of a building 256 ft high. With what velocity will it strike the ground? What is it acceleration

Answers

Answer:

128 ft / second.

Step-by-step explanation:

It's acceleration is due to gravity and is 32 ft s^-2.

To find the velocity when it hits the ground we use the equation of motion

v^2 = u^2 + 2gs    where  u = initial velocity, g = acceleration , s = distance.

v^2 = 0^2 + 2 * 32 * 256

v^2 = 16384

v =  128 ft s^-1.

Final answer:

The rock will strike the ground with a velocity of 128 ft/s and will experience an acceleration of 32 ft/s^2.

Explanation:

First, we need to calculate the time it takes for the rock to fall to the ground. We can use the equation h = (1/2)gt^2, where h is the height of the building (256 ft) and g is the acceleration due to gravity (32 ft/s^2). Solving for t, we find t = sqrt(2h/g) = sqrt(2(256)/32) = 4 seconds.

Next, we can calculate the velocity of the rock just before it hits the ground. We can use the equation v = gt, where g is the acceleration due to gravity and t is the time it takes to fall (4 seconds). Plugging in the values, we find v = (32 ft/s^2)(4s) = 128 ft/s.

Lastly, the acceleration of the rock is equal to the acceleration due to gravity, which is 32 ft/s^2.

Learn more about Physics here:

https://brainly.com/question/32123193

#SPJ2

Given F= {(0,1), (2,4), (4,6), (6,8)} and G= {(2,5), (4,7), (5,8), (6,9), (7,5)}(F-G) (6)

Answers

Answer:

(F-G)(x) = -1

Step-by-step explanation:

The notation (F - G)(x) means to subtract each function when x = 6. According to the sets when x = 6 then F is (6,8) and G is (6,9). To subtract the functions, subtract their output values. (F-G)(x) = 8 - 9 = -1.

Find the exact value by using a half-angle identity.

tangent of seven pi divided by eight

tan (7pi/8)

please show step by step

Answers

Answer:

The exact form of [tex]\tan(\frac{7\pi}{8})[/tex] is [tex]-\sqrt{2}+1[/tex]

Step-by-step explanation:

We need to find the exact value of [tex]\tan(\frac{7\pi}{8})[/tex] using half angle identity.

Since, [tex]\frac{7\pi}{8}[/tex]  is not an angle where the values of the six trigonometric functions are known, try using half-angle identities.

[tex]\frac{7\pi}{8}[/tex]  is not an exact angle.

First, rewrite the angle as the product of [tex]\frac{1}{2}[/tex] and an angle where the values of the six trigonometric functions are known. In this case,

[tex]\frac{7\pi}{8}[/tex] can be written as ;

[tex](\frac{1}{2})\frac{7\pi}{4}[/tex]

Use the half-angle identity for tangent to simplify the expression. The formula states that [tex] \tan \frac{\theta}{2}=\frac{\sin \theta}{1+ \cos \theta}[/tex]

[tex]=\frac{\sin(\frac{7\pi}{4})}{1+ \cos (\frac{7\pi}{4})}[/tex]

Simplify the numerator.

[tex]=\frac{\frac{-\sqrt{2}}{2}}{1+ \cos (\frac{7\pi}{4})}[/tex]

Simplify the denominator.

[tex]=\frac{\frac{-\sqrt{2}}{2}}{\frac{2+\sqrt{2}}{2}}[/tex]

Multiply the numerator by the reciprocal of the denominator.

[tex]\frac{-\sqrt{2}}{2}\times \frac{2}{2+\sqrt{2}}[/tex]

cancel the common factor of 2.

[tex]\frac{-\sqrt{2}}{1}\times \frac{1}{2+\sqrt{2}}[/tex]

Simplify,

[tex]\frac{-\sqrt{2}(2-\sqrt{2})}{2}[/tex]

[tex]\frac{-(2\sqrt{2}-\sqrt{2}\sqrt{2})}{2}[/tex]

[tex]\frac{-(2\sqrt{2}-2)}{2}[/tex]

simplify terms,

[tex]-\sqrt{2}+1[/tex]

Therefore, the exact form of [tex]\tan(\frac{7\pi}{8})[/tex] is [tex]-\sqrt{2}+1[/tex]

The exact value of [tex]\( \tan\left(\frac{7\pi}{8}\right) \)[/tex] is [tex]\( \frac{2 - \sqrt{2}}{\sqrt{2}} \)[/tex].

To find the exact value of [tex]\( \tan\left(\frac{7\pi}{8}\right) \)[/tex] using the half-angle identity, we proceed as follows:

1. Identify the appropriate half-angle identity:

  The tangent half-angle identity is given by:

  [tex]\[ \tan\left(\frac{\theta}{2}\right) = \frac{1 - \cos(\theta)}{\sin(\theta)} \][/tex]

2. Apply the identity for [tex]\( \theta = \frac{7\pi}{4} \)[/tex] :

  First, determine [tex]\( \theta = \frac{7\pi}{4} \)[/tex] , then find [tex]\( \frac{\theta}{2} \)[/tex].

3. Calculate [tex]\( \cos\left(\frac{7\pi}{4}\right) \)[/tex] and [tex]\( \sin\left(\frac{7\pi}{4}\right) \)[/tex]:

  [tex]\[ \cos\left(\frac{7\pi}{4}\right) = \cos\left(\frac{2\pi + \frac{\pi}{4}}{2}\right) = \cos\left(\frac{\pi}{4}\right) = \frac{\sqrt{2}}{2} \][/tex]

  [tex]\[ \sin\left(\frac{7\pi}{4}\right) = \sin\left(\frac{2\pi + \frac{\pi}{4}}{2}\right) = \sin\left(\frac{\pi}{4}\right) = \frac{\sqrt{2}}{2} \][/tex]

4. Apply the half-angle identity:

  [tex]\[ \tan\left(\frac{7\pi}{8}\right) = \frac{1 - \cos\left(\frac{7\pi}{4}\right)}{\sin\left(\frac{7\pi}{4}\right)} = \frac{1 - \frac{\sqrt{2}}{2}}{\frac{\sqrt{2}}{2}} \][/tex]

5. Simplify:

  [tex]\[ \tan\left(\frac{7\pi}{8}\right) = \frac{2 - \sqrt{2}}{\sqrt{2}} \][/tex]

Therefore, [tex]\( \tan\left(\frac{7\pi}{8}\right) = \frac{2 - \sqrt{2}}{\sqrt{2}} \)[/tex].

Using the half-angle identity for tangent, we substituted [tex]\( \theta = \frac{7\pi}{4} \)[/tex] and calculated [tex]\( \cos\left(\frac{7\pi}{4}\right) \)[/tex] and [tex]\( \sin\left(\frac{7\pi}{4}\right) \)[/tex] to find [tex]\( \tan\left(\frac{7\pi}{8}\right) \)[/tex] in exact form.

Tom walks 1/3 of a mile in 1/4 of an hour. At this rate, how many miles will tom walk in 1 hour ?

Answers

Tom walks at a rate of 4/3 miles per hour, which means he will walk 1.333 miles in one hour at this rate.

To find out how many miles Tom will walk in 1 hour, we need to determine the distance he covers in 1/4 of an hour and then calculate how much he would walk in 1 hour at that rate.

Given Tom walks 1/3 of a mile in 1/4 of an hour, first find how much he walks in 1 hour:
1/3 mile ÷ (1/4 hour) = 1/3 mile * 4/1 hour = 4/3 miles in 1 hour

Therefore, Tom will walk 4/3 miles in 1 hour at that pace.

Tom would walk 4/3 miles or 1 and 1/3 miles in 1 hour given that he walks 1/3 of a mile in 1/4 of an hour based on the unit rate calculation.

The question deals with finding out how many miles Tom will walk in 1 hour if he walks 1/3 of a mile in 1/4 of an hour. To calculate this, we use the concept of a unit rate, which is finding how much of something is done in one unit of something else, in this case, miles per hour. Since Tom walks 1/3 of a mile in 1/4 of an hour, we can set up a proportion to find out how many miles he would walk in 1 full hour.

The proportion is: (1/3) miles / (1/4) hour = x miles / 1 hour. To solve for x, we multiply both sides of the equation by 1 hour so x would equal (1/3) miles \/ (1/4) hour. To simplify the right side, we invert the fraction in the denominator and multiply:
x = (1/3) miles \/ (1/4). When we multiply by the reciprocal of 1/4, which is 4, we get x = (1/3) \/ 1 \/ 4 = 4/3 miles.

Therefore, at this rate, Tom would walk 4/3 miles or 1 and 1/3 miles in 1 hour.

To fill a planting bed, Mr.Carver uses 5 buckets of soil to 4 buckets peat moss. He needs to use 324 buckets in all to fill the bed. How many buckets of soil and peat moss will he use?


please help bc i am kristinas little sister :(

Answers

Buckets of Soil : Buckets of Peat Moss = 5 : 4

Since Mr Carver needs to use 324 buckets in all,

He needs to use 324 * 5/9 = 180 buckets of Soil and 324 * 4/9 = 144 buckets of Peat Moss.

Mr. Carver will use 180 buckets of soil and 144 buckets of peat moss to fill the planting bed, based on the given ratio of 5 buckets of soil to 4 buckets of peat moss.

The problem at hand revolves around ratios and proportions where Mr. Carver is using a mix of soil and peat moss in a specific ratio to fill a planting bed. Given the ratio of 5 buckets of soil to 4 buckets of peat moss, we need to find the total number of buckets for each that will sum up to 324 buckets. First, we'll find the total number of parts in the ratio by adding 5 (for soil) and 4 (for peat moss), which gives us 9 parts. Since we have the total amount of 324 buckets, we can find the value of one part by dividing 324 by 9, which gives us 36.

Once we have the value of one part, we multiply it by the number of parts for soil and peat moss to find their respective quantities:

Soil: 5 parts x 36 buckets per part = 180 bucketsPeat moss: 4 parts x 36 buckets per part = 144 buckets

Therefore, Mr. Carver will use 180 buckets of soil and 144 buckets of peat moss to fill the planting bed.

Maria did the work to see if 8 is a solution to the equation s-3=11.

s-3=11
8-3=11
5=11

Does her work show that 8 a solution to the equation?

A.)Yes, because the last line of the work is true.
B.)Yes, because 11 minus 8 equals 3.
C.)No, because 8 is even and the other numbers in the equation are odd.
D.)No, because the last line of the work is not true. 5 and 11 are not equal.

Answers

Answer: Option D.

Step-by-step explanation:

The expressions of boths sides of the equation must have the same value Or, in other words, if we call the expresion on the left side of the equation A, and the expression on the right side of the equation B, then:

[tex]A=B[/tex]

Keeping the above on mind, you can see that 5 and 11 are not equal, then:

5≠11

The correct value of s is:

[tex]s-3=11\\s=11+3\\s=14[/tex]

Substituting:

[tex]14-3=11\\11=11[/tex]

Answer:

No, because the last line of the work is not true. 5 and 11 are not equal.

Step-by-step explanation:

PLEASE HELP What is the radical form of the expression 423 ? 43−−√ 34−−√ 42−−√3 24−−√3

Answers

For this case we must express the number "423" in a radical way.

We have to, we can rewrite it as:

[tex]423 = 9 * 47 = 3 ^ 2 * 47[/tex]

So, we have to:

[tex]423 = \sqrt {3 ^ 2 * 47}[/tex]

By definition of properties of powers and roots we have:

[tex]\sqrt [n] {a ^ m} = a ^ {\frac {m} {n}}[/tex]

So:

[tex]423 = \sqrt {3 ^ 2 * 47} = 3 \sqrt {47}[/tex]

Answer:

[tex]3 \sqrt {47}[/tex]

Answer:

3^√4^2

Step-by-step explanation:

Solve the system using elimination. Write the solution as an ordered pair. (1 point) SHOW YOUR WORK FOR FULL CREDIT! (2 points)

5x + 4y = 1
-3x + 4y = -7

Answers

Final answer:

By using elimination to subtract the second equation from the first, we solve for x and then substitute x back into one of the original equations to solve for y, finding the solution as the ordered pair (1, -1).

Explanation:

To solve the system using elimination, we look at the given equations:

1) 5x + 4y = 1
2) -3x + 4y = -7

The goal is to eliminate one variable to solve for the other. In this case, we can subtract the second equation from the first one since they both have the same coefficient for y, which will eliminate the y variable.

5x + 4y = 1
-(-3x + 4y = -7)5x + 4y - (-3x + 4y) = 1 - (-7)5x + 4y + 3x - 4y = 1 + 78x = 8x = 1

Now that we have found x, we can substitute x into one of the original equations to find y:

5(1) + 4y = 1

5 + 4y = 14y = 1 - 54y = -4y = -1

The solution to the system is (1, -1), which is an ordered pair representing the x and y values that satisfy both equations.

Find the slope of the line
40 Points!

Answers

Answer:

-1/2

Step-by-step explanation:

Rise in X / Rise in Y

1 / 2 = 1/2

The answer to ur question is slope =-1/2

The cost of three tickets to a movie is at least $20. Select an inequality that represents the cost x (in dollars) of each ticket. Then solve the inequality. Write your solution in decimal form rounded to the nearest cent.

Answers

Answer:

3x=$20

Step-by-step explanation:

well first you divide    3x/3=$20/3                      

3 can go into 20 6 times that                                                                                                          would 18 and then u would have a remainder of 2 dollars and 3 cant go into 2 so it would be .67 so x=6.67

Find the circumference of the circle in terms of pi? [30]

Answers

Answer:

60π

Step-by-step explanation:

If the circle has radius of 30 units, substitute r=30 into the formula C = 2πr.

C = 2π(30)

C = 60π

To find the circumference of the circle shown here, let's start with writing the formula down.

Circumference = 2[tex]\pi[/tex]r

We have to divide 60 by 2 because the radius is always half the diameter. Now, we can plug in 30 for r in the formula.

Now we have

circumference = 2[tex]\pi[/tex]30.

This equals 60[tex]\pi[/tex].

PLEASE HELP!! TIMED QUESTION!!
Solve for x.
y=x^2 +23

A. x= +/- sq root y +23
B. x = y - 23
C. x= +/- sq root y = 23
D. x = y + 23

Answers

y=×^2+23

Answer letter B

×=y-23

Consider the following problem: A box with an open top is to be constructed from a square piece of cardboard, 3 ft wide, by cutting out a square from each of the four corners and bending up the sides. Find the largest volume that such a box can have. Let x denote the length of the side of the square being cut out. Let y denote the length of the base.
(a) Draw several diagrams to illustrate the situation, some short boxes with large bases and some tall boxes with small bases. Find the volumes of several such boxes. (Do this on paper. Your teacher may ask you to turn in this work.)

(b) Draw a diagram illustrating the general situation. Introduce notation and label the diagram with your symbols. (Do this on paper. Your teacher may ask you to turn in this work.)

(c) Write an expression for the volume V in terms of x and y.
V =


(d) Use the given information to write an equation that relates the variables. (Do this on paper. Your teacher may ask you to turn in this work.)

(e) Use part (d) to write the volume as a function of x.
V(x) =


(f) Finish solving the problem by finding the largest volume that such a box can have.
V = ft3

Answers

Final answer:

The largest volume that the box can have is 2.25 ft^3, and it's obtained when x = 0.5 ft. This came from a mathematical analysis of the volume function V(x) = 4x^3 - 12x^2 + 9x.

Explanation:

Given that a square is cut from each corner of the cardboard to form an open box, we can come up with the following: The width of the base, represented by y, would be equal to the initial width of the cardboard (3 ft) minus two times the sides of the squares being cut out (2x), so y = 3 - 2x. Part c: will be the Volume of the box which is given by V = x * y^2, substituting for y from the relation obtained above we get. Part d: V = x * (3 - 2x)^2. Part e: is just the simplification of the equation obtained in part d: V(x) = 4x^3 - 12x^2 + 9x. Part f: To find the maximum volume, we need to find the critical points of the V(x) function, these are obtained by setting the derivative of the function equal to zero, solving for x will give x = 0.5 and x =1.5 but since x > 1.5 would give a negative y, the maximum volume is obtained at x = 0.5, substituting this x into the V(x) equation gives V = 2.25 ft^3.

Learn more about Maximizing Volume here:

https://brainly.com/question/32196877

#SPJ3

Andrew plays 1/4 of a song in 1/8 of a minute. How much time, in minutes, does it take him to play an entire song?

Answers

1/4 = 1/8

times by 4 to find the whole song as 1/4 × 4 is 1

1 = 4/8

4/8 = 1/2 of a minute

Graph the function. Describe its position relative to the graph of the indicated basic function.
f(x)= 4^x-3 ; relative to f(x)= 4^x

Answers

Answer:

The answer is (b) moved right 3 units and moved down 3 units

Step-by-step explanation:

∵ f(x) = 4^x ⇒ red in the graph

∵ f(x) = 4^(x-3) - 3 ⇒ blue in the graph

x  becomes x - 3 ⇒ means:

 The graph moved right 3 units

∵ f(x) = 4^x becomes 4^(x-3) - 3 ⇒ means:

  The graph moved down 3 units

∴ The answer is (b)

The graph of f(x) = 4ˣ - 3  is shifted down 3 units compared to the graph of f(x) = 4ˣ

What is an exponential function?

An exponential function is in the form:

y = abˣ

Where y,x are variables, a is the initial value of y and b is the multiplication factor.

The graph of f(x) = 4ˣ - 3 and f(x) = 4ˣ is attached.

The graph of f(x) = 4ˣ - 3  is shifted down 3 units compared to the graph of f(x) = 4ˣ

Find out more on exponential function at: https://brainly.com/question/12940982

Find the polar equation of the conic with the focus at the pole, directrix x = 4, and eccentricity 1.
(picture provided)

Answers

Answer:

Choice D is correct

Step-by-step explanation:

The eccentricity of the conic section is 1, implying we are looking at a parabola. Parabolas are the only conic sections with an eccentricity of 1.

Next, the directrix of this parabola is located at x = 4. This implies that the parabola opens towards the left and thus the denominator of its polar equation contains a positive cosine function.

Finally, the value of k in the numerator is simply the product of the eccentricity and the absolute value of the directrix;

k = 1*4 = 4

This polar equation is given by alternative D

1. C = 2(pi)r and C = d(pi) are the formulas for finding the _____________ of a circle.

Answers

Answer:

Circumference

Step-by-step explanation:

The circumference is the distance around the circle. It relates the number of times the diameter will encircle the circumference as 3.14 or π. As a result, the formulas for the circumference of a circle are C = 2πr and C = πd.

Two less than 3 times a number is the same as the number plus 10. What is the number?

Answers

This should help

3 * a - 2 = a + 10


2x + y = 3
x - 2y = -1

If equation one is multiplied by 2 and then the equations are added, the result is _____.


3x = 2
3x = 5
5x = 5




Answers

multiply 2x+y = 3 by 2

4x + 2y = 6

x - 2y = -1

add terms (be careful about signs!)

5x + 0 = 2

5x = 5

Answer:

5x=5

Step-by-step explanation:

MATH HELP PLEASE I WILL MARK BRAINLIEST 1st and 2nd picture are both for question 1 the 3rd picture is a different question

Kerim bought a $2,000 bicycle. The bicycle's value depreciates, or decreases, by $300 a year. Which graph represents this situation?

Answers

Answer:First one is D

Step-by-step explanation:

The graph passses through the pints neccessary for it to decrease by 300

Part A: The product of (n2 – 6n + 3) and -4n is
A. -4n^3+24n^2+12n
B. -4n^3+24n^2-12n
C. 4n^3+24n^2-12n

Part B: When this product is multiplied by -n, the result is
A. 4n^4-24n^3+12n^2
B. -4n^4+24n^3+12n^2
C. 4n^4+24n^3+12n^2

Answers

Answer:

Part A) Option B. [tex]-4n^{3}+24n^{2}-12n[/tex]

Part B) Option A. [tex]4n^{4}-24n^{3}+12n^{2}[/tex]

Step-by-step explanation:

Part A) we have

[tex](n^{2}-6n+3)(-4n)[/tex]

the product is equal to

[tex]=(n^{2})(-4n)-6n(-4n)+3(-4n)\\=-4n^{3}+24n^{2}-12n[/tex]

Part B) When this product is multiplied by -n, the result is

we have

[tex](-4n^{3}+24n^{2}-12n)(-n)[/tex]

[tex]=(-4n^{3})(-n)+24n^{2}(-n)-12n(-n)\\=4n^{4}-24n^{3}+12n^{2}[/tex]

23 points help asap
Which two categories, when added together, equal 65% of the credit score wheel?

Answers

Payment history and total debt

Payment history = 35%
Total debt = 30%

35% + 30% = 65%

add payment history and total debt it gibes you 65%

Identify the graph of x^2-5x+y^2=3 for theta π/3 and write and equation of the translated or rotated graph in general form.

Answers

Answer:

The answer is circle; 2(x')² + 2(y')² - 5x' - (5√3)y' - 6 = 0 ⇒ answer (b)

Step-by-step explanation:

* At first lets talk about the general form of the conic equation

- Ax² + Bxy + Cy²  + Dx + Ey + F = 0

∵ B² - 4AC < 0 , if a conic exists, it will be either a circle or an ellipse.

∵ B² - 4AC = 0 , if a conic exists, it will be a parabola.

∵ B² - 4AC > 0 , if a conic exists, it will be a hyperbola.

* Now we will study our equation:

* x² - 5x + y² = 3

∵ A = 1 , B = 0 , C = 1

∴ B² - 4AC = (0) - 4(1)(1) = -4 < 0

∵ B² - 4AC < 0

∴  it will be either a circle or an ellipse

* Lets use this note to chose the correct figure

- If A and C are equal and nonzero and have the same sign,

 then the graph is a circle.

- If A and C are nonzero, have the same sign, and are not equal

 to each other, then the graph is an ellipse.

∵ A = 1 an d C = 1

∴ The graph is a circle.

* To find its center of the circle lets use

∵ h = -D/2A and k = -E/2A

∵ A = 1 and D = -5 , E = 0

∴ h = -(-5)/2(1) = 2.5 and k = 0

∴ The center of the circle is (2.5 , 0)

* Now lets talk about the equation of the circle and angle Ф

∵ Ф = π/3

- That means the graph of the circle will transformed by angle = π/3

- The point (x , y) will be (x' , y'), where

* x = x'cos(π/3) - y'sin(π/3) , y = x'sin(π/3) + y'cos(π/3)

∵ cos(π/3) = 1/2 and sin(π/3) = √3/2

∴ [tex]y=\frac{\sqrt{3}}{2}x'+\frac{1}{2}y'=(\frac{\sqrt{3}x'+y'}{2})[/tex]

∴ [tex]x=\frac{1}{2}x'-\frac{\sqrt{3}}{2}y'=(\frac{x'-\sqrt{3}y'}{2})[/tex]

* Lets substitute x and y in the equation x² - 5x + y² = 3

∵ [tex](\frac{x'-\sqrt{3}y'}{2})^{2}-5(\frac{x'-\sqrt{3}y'}{2})+(\frac{\sqrt{3}x'-y'}{2})^{2}=3[/tex]

* Lets use the foil method

∴ [tex]\frac{(x'^{2} -2\sqrt{3}x'y'+3y')}{4}-\frac{(5x'-5\sqrt{3}y')}{2}+\frac{(\sqrt{3}x'+2\sqrt{3}x'y'+y'^{2})}{4}[/tex]=3

* Make L.C.M

∴ [tex]\frac{(x'^{2}-2\sqrt{3}x'y'+3y'^{2})}{4}-\frac{(10x'-10\sqrt{3}y')}{4}+\frac{(3x'^{2}+2\sqrt{3}x'y'+y'^{2})}{4} =3[/tex]

* Open the brackets ∴[tex]\frac{x'^{2}-2\sqrt{3}x'y'+3y'^{2}-10x'+10\sqrt{3}y'+3x'^{2}+2\sqrt{3}x'y'+y'^{2}}{4}=3[/tex]

* Collect the like terms

∴ [tex]\frac{4x'^{2}+4y'^{2}-10x'+10\sqrt{3}y'}{4}=3[/tex]

* Multiply both sides by 4

∴ 4(x')² + 4(y')² - 10x' + (10√3)y' = 12

* Divide both sides by 2

∴ 2(x')² + 2(y')² - 5x' + (5√3)y' = 6

∵ h = -D/2A and k = E/2A

∵ A = 2 and D = -5 , E = 5√3

∴ h = -(-5)/2(2) = 5/4 =1.25

∵ k = (5√3)/2(2) = (5√3)/4 = 1.25√3

∴ The center of the circle is (1.25 , 1.25√3)

∵ The center of the first circle is (2.5 , 0)

∵ The center of the second circle is (1.25 , 1.25√3)

∴ The circle translated Left and up

* 2(x')² + 2(y')² - 5x' - (5√3)y' - 6 = 0

∴ The answer is circle; 2(x')² + 2(y')² - 5x' - (5√3)y' - 6 = 0

* Look to the graph

- the purple circle for the equation x² - 5x + y² = 3

- the black circle for the equation (x')² + (y')² - 5x' - 5√3y' - 6 = 0

Answer:

B

Step-by-step explanation:

edge

What is the value of X to the nearest tenth in the triangle below? the triangle is not drawn to scale

Answers

Answer:

x = 13.9

Step-by-step explanation:

With respect to the angle shown, we have the hypotenuse (the side opposite the 90 degree angle) and we have the adjacent side (which is the side labeled x). thus we can use the ratio "cosine" to solve this.

The ratio of cosine is defined as:

[tex]Cos\theta=\frac{Adjacent}{Hypotenuse}[/tex]

Where adjacent and hypotenuse are the respective sides and [tex]\theta[/tex] is the angle

Thus, we can now write:

[tex]Cos\theta=\frac{Adjacent}{Hypotenuse}\\Cos(35)=\frac{x}{17}\\Cos(35)*17=x\\x=13.9[/tex]

The first answer choice is right, x = 13.9

The value of X to the nearest tenth in the triangle is 13.9.  

We have the neighboring side, which is the side with the letter x, and the hypotenuse, which is the side across from the 90-degree angle, with regard to the angle displayed.

Therefore, the ratio "cosine" can be used to solve this.

The definition of the cosine ratio is:  [tex]Cos \theta[/tex] = Adjacent side / hypotenuse.

where the angle and the corresponding sides are called the hypotenuse and adjacent.

So that we may write now:

[tex]Cos(35)= \frac{x}{17}[/tex]

[tex]Cos(35) \times 17 = x[/tex]

Therefore 13.9 = x  .

For similar question on triangle.

https://brainly.com/question/25215131

#SPJ3

Please help me out with this question, THANKS!

Answers

Answer:

line B.)

Step-by-step explanation:

2x+5y=10

5y=-2x+20

(5y/5) (2x+10/5)

y= (-2/5)x +2

The graph represents the ways Janelle can win the beanbag toss game. Which describes a way Janelle can win the game? land on round 7 times; land on square 1 time land on round 6 times; land on square 2 times land on round 5 times; land on square 3 times land on round 4 times; land on square 4 times

Answers

Answer:

Land on round 4 times; land on square 4 times

Step-by-step explanation:

Answer:

The correct option is 4.

Step-by-step explanation:

In the graph orange region represents the ways Janelle can win the beanbag toss game.

From the given graph it is clear that the related line passes through the points (2,5) and (10,0).

If a line passes through two points, then the equation of line is

[tex]y-y_1=\frac{y_2-y_1}{x_2-x_1}(x-x_1)[/tex]

The equation of related line is

[tex]y-5=\frac{0-5}{10-2}(x-2)[/tex]

[tex]y-5=-\frac{5}{8}(x-2)[/tex]

Add 5 on both the sides.

[tex]y-5+5=-\frac{5}{8}(x)+\frac{5}{4}+5[/tex]

[tex]y=-\frac{5}{8}(x)+\frac{25}{4}[/tex]

The shaded region is above the line, so the sign of inequality is ≥.

The required inequality is

[tex]y\geq -\frac{5}{8}(x)+\frac{25}{4}[/tex]

Check the each point whether it satisfy the inequality of not.

In option (1), the given point is (7,1).

[tex]1\geq -\frac{5}{8}(7)+\frac{25}{4}[/tex]

[tex]1\geq 1.875[/tex]

This statement is false.

In option (2), the given point is (6,2).

[tex]2\geq -\frac{5}{8}(6)+\frac{25}{4}[/tex]

[tex]2\geq 2.5[/tex]

This statement is false.

In option (3), the given point is (5,3).

[tex]3\geq -\frac{5}{8}(5)+\frac{25}{4}[/tex]

[tex]3\geq 3.125[/tex]

This statement is false.

In option (4), the given point is (4,4).

[tex]4\geq -\frac{5}{8}(4)+\frac{25}{4}[/tex]

[tex]3\geq 3.75[/tex]

This statement is true. It means the point (4,4) describes a way Janelle can win the game. Therefore the correct option is 4.

PLEASE HELP!!!

Is investing $4,000 at an interest rate of 5% (compounded annually) and $4,000 at an interest rate of 7% (compounded annually) always, sometimes, or never the same as investing $8,000 (the total of the two principals) at an interest rate of 6% (compounded annually)? Why or why not? Does it matter how long you leave it in the account?

Explain using words and examples, and justify your answer.

Answers

No, it is not the same because in option 1, the interest is calculated based on two different principal amounts and then added together. The principal amounts will be different every year because of the varying interest rates. Since one of the interest rates in option 1 is 7%, the principal will grow at a faster rate because the interest rate is applied to a greater and greater principal amount over time. In option 2, the interest is being calculated only on one principal  

Answer:

Step-by-step explanation:

No, they are not always the same - the only time that they will be the same is after the first year:

$4000*1.05 + $4000*1.07 = $8480 = $8000*1.06

From there on, they will diverge. For example after the second year:

$4000*1.05^2 + $4000*1.07^2 = $8989.6

$8000*1.06^2 = $8988.8

After the third year:

$4000*1.05^3 + $4000*1.07^3 = $9530.672

$8000*1.06^3 = $9528.128

After the nth year:

The first option gives $4000*(1.05^n + 1.07^n)

The second option gives $8000*(1.06^n)

= $4000*(2)*(1.06^n)

= $4000*(1.06^n + 1.06^n)

Because 1.07^n - 1.06^n > 1.06^n - 1.05^n for n>1, the first option will be a better investment.

If you're any good at compound inequalities.

Cindy has $20 to spend at the store. She buys a pack of colored pencils that cost $4 and jelly beans that cost $2 per pound. If she spends more than $8 at the store, write a compound inequality that shows the possible number of pounds of jelly beans she could have purchased.

Answers

Answer:

Step-by-step explanation:

Let x be the amount of colored pencils she buys, and let y be the number of jelly beans that she buys. We have the following inequalities..

4x + 2y ≤ 20     (the cost times the amount has to be less than or equal to 20)

4x + 2y > 8       (she spends more than $8)

We can rewrite the inequality like this...

8 < 4x + 2y ≤ 20

Now reduce since all coefficients are even, they can be divided by 2

4 < 2x + y ≤ 10

We want values of x and y that can satisfy the situation.  

There are many points,

If x = 1, then you can have y =3 to 8

If x = 2,  then you can have y = 1 to 6  

If x = 3, then you can have y = 1 to 4

If x = 4, then you can have y = 1 or 2

x = 5,  the y = o

Final answer:

To find the possible number of pounds of jelly beans Cindy could purchase, we set up a compound inequality considering the $4 spent on colored pencils and the $2 per pound cost of jelly beans. Solving the inequality 4 < 4 + 2x < 20 gives us the range 0 < x < 8, meaning Cindy could have bought more than 0 pounds but less than 8 pounds of jelly beans.

Explanation:

To solve the problem involving Cindy's shopping at the store, let's create a compound inequality with the following conditions: she has $20 to spend, she has already spent $4 on colored pencils, and the jelly beans cost $2 per pound. Cindy wants to spend more than $8 in total at the store, which includes the cost of the pencils and the jelly beans.

Let's define x as the number of pounds of jelly beans that Cindy can purchase. The cost of the jelly beans is $2 per pound, so the total cost for the jelly beans is $2x.

Since she spent $4 on pencils, adding the cost of the jelly beans needs to be more than $4 (to exceed the $8 total spending) but less than $20 (to stay within her budget). Hence, the compound inequality will be:

4 < 4 + 2x < 20

Now let's solve for x:

First, subtract 4 from all parts of the inequality:

0 < 2x < 16

Next, divide all parts by 2:

0 < x < 8

The solution tells us that Cindy could have purchased more than 0 but less than 8 pounds of jelly beans.

Your company has a plan that matches your retirement contributions up to 2% of your salary. Your annual salary is $22,000. You are paid bi-weekly (26 times per year). How much should you contribute to the retirement account each pay period to take full advantage of the company match

Answers

Answer:

The contribution is $ [tex]16.92\\[/tex] per biweekly payment

Step-by-step explanation:

Salary received in each of the [tex]26 \\[/tex] pay is

[tex]\frac{2}{100} * \frac{22000}{26} \\= 16.92\\[/tex]

Final answer:

To take full advantage of your company's retirement match, contribute at least $16.92 from each bi-weekly paycheck to your retirement account, which is 2% of your annual salary divided by 26 pay periods.

Explanation:

To determine how much you should contribute to the retirement account each pay period to take full advantage of the company match, you need to calculate 2% of your annual salary and then divide that number by the number of pay periods in a year. Here's the step-by-step calculation:

Calculate 2% of your annual salary ($22,000): 0.02 × $22,000 = $440.Divide the annual match by the number of pay periods: $440 ÷ 26 = approximately $16.92.

To fully utilize the company's matching program, you should contribute at least $16.92 from each bi-weekly paycheck to your retirement account.

Other Questions
What is measure of angle R?Enter your answer as a decimal in the box. Round only your final answer to the nearest hundredth.P Q R is a right triangle. Q is a right angle. P Q is equal to five centimeters, Q R is equal to twelve centimeters and P R is equal to thirteen centimeters. Two large influences on the development of English words were Consider the following balanced equation. SiO2(s)+3C(s)SiC(s)+2CO(g) Complete the following table, showing the appropriate number of moles of reactants and products. If the number of moles of a reactant is provided, fill in the required amount of the other reactant, as well as the moles of each product formed. If the number of moles of a product is provided, fill in the required amount of each reactant to make that amount of product, as well as the amount of the other product that is made. molSiO2 molC molSiC molCO _____ 9 _____ _____ 1 _____ _____ _____ _____ _____ _____ 26 _____ 7.5 _____ _____ 1.4 _____ _____ _____ Part A Complete the first row. The ancient romans created a number of pictorial stained glass pieces Solving Rational Equations. LCD Method. Show work.[tex]\frac{3}{5x} + \frac{7}{2x} =1[/tex] Is "someone else asked me if my family ate dogs every day or only once in a while" is an example of a hyperbole I have no clue how to do this If 2/3x-1=4,then x=A)15/2B)8/2C)13/3D)10/3 Which of the following is NOT a key component of stretching?a. breathe deeply and regularlyb. hold each stretch for at least 15 secondsc. move quickly, completing as many stretches as you can in a 5-minute periodd. always use controlled motion Find the length of segment BA.A) 163.3B) 128.6C) 84.7D) 59.8 simplify the trigonometric expression. show your work please hurryWhat is the surface area of the cylinder? Express the answer in terms of pi. Keeping long-term customers is more beneficial than continually acquiring new customers because: What is the purpose of a monologue? A. To share a speakers Thoughs without other characters hearing. B. To disclose a speakers thoughts quietly with another character. C. To express a speakers innermost thoughts only to himself or herself. D. To reveal a speakers thoughts to the audience or other characters. Axel draws a cladogram containing a zebra, bear, lion, and tiger. He uses the physical appearances of the animals to decide where they should be placed in his cladogram. Is he correct? Why or why not? The technique of action painting was used by artists of which postWorld War II art movement? The sum of the digits of a two-digit number is 11. The tens digit is one less than three times the ones digit. Find the original number. How did this map change following the Treaty of Washington in 1846? (70 points) The Oregon Country was divided between Britain and the United States at the 49th Parallel. The Oregon Country was split into the Washington and Oregon Territories using the 49th Parallel as the new boundary.The boundary between the Oregon Country and Mexico was shifted from the 42nd Parallel to the Oregon Trail route.The portion of the Oregon Country below the 49th Parallel became part of Mexico, while the portion above the 49th Parallel became part of Great Britain. In Spanish, the verb ______ is used to tell how someone feels or where a person or thing is located. U.S. and Global Economics:Governments have the ability to use a person's private property for its own purposes but must compensate the person monetarily. This power is referred to asA.) Due processB.) Eminent domainC.) Implied powers D.) Delegated powers Steam Workshop Downloader