You have done 3,404 J of work with a force of 37 N on a 46-kg object. Over what distance did you do the work?
A. 92 m
B. 150 m
C. 3131 m
D. 1702 m
^_^ ...?

Answers

Answer 1
work = force x distance

37 x D  = 3404 J

D = 3404 / 37

D = 92m

hope this helps

Related Questions

a 727 jet needs to attain a speed of 200 mph to take off. if it can accelerate from 0 to 200 mph in 30 seconds, how long must the runway be? (assume constant acceleration) ...?

Answers

Thank you for posting your question here at brainly. I hope the answer will help you. Feel free to ask more questions here.

Since v = dx/dt = 200t

I took the integral of dx = integral of 200t dt

and I got x = 100t^2 + C

So I plugged in 0.5 as t and got x = 25

So x = 25 miles
Final answer:

Using the equations of motion, the length of the runway required for the 727 jet to take off can be determined. By calculating the acceleration and using the distance formula, we find that the runway must be at least 44.7039 meters long.

Explanation:

To determine the length of the runway required for the 727 jet to take off, we can use the equations of motion.

First, convert the speed from mph to m/s: 1 mph = 0.44704 m/s.Next, calculate the acceleration of the jet using the formula:acceleration = change in velocity / timeGiven: final velocity = 200 mph = 200 * 0.44704 = 89.408 m/sInitial velocity = 0 m/sTime = 30 secondsacceleration = (89.408 - 0) / 30 = 2.98027 m/s².Finally, use the equation:distance = initial velocity * time + (1/2) * acceleration * time²Given: initial velocity = 0 m/sacceleration = 2.98027 m/s²time = 30 secondsdistance = 0 * 30 + (1/2) * 2.98027 * (30)² = 0 + 44.7039 = 44.7039 meters

Therefore, the runway must be at least 44.7039 meters long for the 727 jet to take off.

Cindy runs 2 kilometers every morning. She takes 2 minutes for the first 250 meters, 4 minutes for the next 1,000 meters, 1 minute for the next 350 meters, and 3 minutes for the rest.

Cindy’s average speed for the entire run is __ meters per minute. One kilometer is the same as 1,000 meters.

Hint: Average Speed = Total Distance/Total Time

Answers

It's 200 on Edmentum

The waves with the lowest energy and lowest frequencies of the electromagnetic spectrum are the
a. x rays.
b. radio waves.
c. microwaves.
d. gamma rays.

Answers

The waves with the lowest energy and lowest frequencies of the electromagnetic spectrum are the "Radio waves"

So, option B is your answer

Hope this helps!

The gravitational force between the Sun (mass = 1.99 × 1030 kg) and Mercury (mass = 3.30 × 1023 kg) is 8.99 × 1021 N. How far is Mercury from the Sun?

Answers

The answer is B - 6.98 x 10^7 km

Answer : Distance, d=6.98 × 10⁷ Km

Explanation :

Given that,

Mass of the sun, m₁ = 1.99 × 10³⁰ kg

Mass of Mercury, m₂ = 3.30 × 10²³ kg

Gravitational force between the sun and mercury, F = 8.99 × 10²¹ N

According to Universal law of gravitation,

[tex]F=G\dfrac{m_1m_2}{d^2}[/tex]

d is the distance of mercury from the sun

[tex]d=\sqrt{\dfrac{Gm_1m_2}{F}}[/tex]

[tex]d=\sqrt{\dfrac{6.67\times 10^{-11}\times 1.99\times {30}\times 3.30\times 10^{23}}{8.99\times 10^{21}}}[/tex]

[tex]d=\sqrt{4.87\times 10^{21}} m[/tex]

[tex]d=6.98\times 10^{10}\ m[/tex]

or

[tex]d=6.98\times 10^{7}\ Km[/tex]

So, mercury is [tex]6.98\times 10^{7}\ Km[/tex] far from the sun.

Which is true about atoms?
a.atoms have no mass
b.atoms are mostly empty space
c.most of the space in an atom is taken up by the nucleus?

Answers

B).atoms are mostly empty space 

This is the only answer. Hope this helps!
B.atoms are mostly empty space


What is the difference between stretching a t shirt and stretching a rubber band?

Answers

It depends on their tension. Normally, the rubber band store more tension than a t shirt.

Magnetic induction is used for what?

Answers

For radio broadcasting, in electricity meters, in any generator. 

If you know the components of a vector, what mathematical relationship can be used to find the magnitude of the vector?

Answers

You will always use Pythagoras theorem to find magnitude while given components of vector.
No matter if system that you are observing is 2D or 3D or higher (which is imaginery) pythagoras theorem will be applied.

Formula for determining magnitude is:
[tex]M = \sqrt{x^ + y^2 + z^2 + ...} [/tex]

Number of turms inside square root you take depending on dimension of your system.

Gas is confined in a tank at a pressure of 11.0 atm and a temperature of 25.0 degrees C. If two-thirds of the gas is withdrawn and the temperature is raised to 75.0 degrees C, what is the new pressure of the gas remaining in the tank?
Please help!

Answers

maybe 3.63 atm I'm not sure though

While skiing, Ellen encounters a ledge that sends her flying horizontally at a rate of 12 m/s. How far away will she land if the ledge is 7 meters high? ...?

Answers

In this problem, we must first calculate that Ellen will be on air. Using the equation of a free-falling body,

y = -g/2*t^2 + y0

When she hits the ground, y = 0. With y0 = 7 and g = 9.80,
0 = -4.90*t^2 + 7
t = 1.20 s

Thus, her horizontal displacement is then
x = vt
x = (12)(1.20)
x = 14.3 m

A 95 kg fullback, running at 8.2 m/s, collides in midair with a 128 kg defensive tackle moving in the opposite direction. Both players end up with zero speed.
A) What was the change in the fullbacks momentum?
B) What Was the change in the defensive momentum?
C) What was the defensive tackle's original momentum?
D) How fast was the defensive tackle moving origianally? ...?

Answers

Thank you for posting your question here at brainly. I hope the answer will help you. Feel free to ask more questions here.

Below is the answers:

Fullback running 

Mo = mass * velocity 
Mo = 95kg * 8.2 m/s =779 kg*m/s (a 

He got stopped Change in Mo = 779 kg*m/s (b 

Both stopped ===> Tackle's mo = - Halfback's Mo = - 779 kg*m/s (c & d 

- 779 = 128 * v 
v= - 6.09 m/s (e

So,option A)Change in the fullback's momentum:779 kg·m/s,B)Change in the defensive tackle's momentum: -779 kg·m/s,C)Defensive tackle's original momentum:-779 kg·m/s (opposite direction),D)The original speed of the defensive tackle:6.09 m/s.

Understanding Momentum and Collision:

A) Change in the fullback's momentum: Momentum is the product of mass and velocity. For the fullback running at 8.2 m/s with a mass of 95 kg, his initial momentum was 95 kg × 8.2 m/s = 779 kg·m/s. After the collision, since they stop, the fullback's speed is 0 m/s, giving a final momentum of 0 kg·m/s. Therefore, the change in momentum is 779 kg·m/s - 0 kg·m/s = 779 kg·m/s.

B) Change in the defensive tackle's momentum: The defensive tackle has mass 128 kg and final speed 0 m/s. Since we are not given the initial velocity, we cannot calculate the change directly; however, by conservation of momentum, the change will be equal and opposite to the fullback's, which is -779 kg·m/s.

C) Defensive tackle's original momentum: As mentioned above, the change in momentum is the negative of the fullback's, so if the fullback's momentum decreased by 779 kg·m/s, the tackle's momentum increased by this amount, meaning it was -779 kg·m/s (opposite direction).

D) The original speed of the defensive tackle: To find the original speed, we take the original momentum (from C) and divide by the tackle's mass. This gives us -779 kg·m/s ÷ 128 kg = -6.09 m/s. The negative indicates that he was moving in the opposite direction to the fullback.

Note that 'negative' here is used to indicate direction in one-dimensional motion, and the actual speed is just the absolute value, 6.09 m/s.

looters break a statue into pieces. how do you expect the weathering of pieces of rock to change

Answers

This definitely has to do with erosion. We can expect that the statue will weather faster because of more surface area.I hope this is what you were looking for

The formula for degrees Celsius is: C = 5/9 (F − 32), where F stands for degrees Fahrenheit.

Part 1: Solve the equation for F and show all steps.
Part 2: Determine how many degrees Fahrenheit 20 degrees Celsius is.

Answers

C = 5/9 (F-32)Part 1.  C=5F/9-(5/9)325F/9=C+160/9F=(9/5)C+(9/5)(160/9)F=(9/5)C+32for part 2:
F=(9/5)20+32F=36+32=68 degrees Fahrenheit

To solve for F in the conversion formula, multiply both sides by 9/5 followed by adding 32 to isolate F. When converting 20 degrees Celsius using the formula, the result is 68 degrees Fahrenheit.

Part 1: Solving the equation for F

To solve the equation C = 5/9 (F - 32) for F, perform the following steps:

Multiply both sides by 9/5 to get rid of the fraction on the right side: 9/5 × C = F - 32.

Add 32 to both sides of the equation to isolate F on one side: 9/5 × C + 32 = F.

Part 2: Converting 20 degrees Celsius to Fahrenheit

To find out how many degrees Fahrenheit 20 degrees Celsius is, plug 20 into the rearranged equation:

F = (9/5) × 20 + 32.

Therefore, F = 36 + 32 = 68 degrees Fahrenheit.

As we learn more, _________ are often revised. scientific laws scientific theories observation experiments

Answers

Here is the answer that would best complete the given statement above. As we learn more, SCIENTIFIC THEORIES are often revised. Scientific theories are considered as the substantial explanation of some aspect of the natural world which are gathered through scientific method. Hope this is the answer that you are looking for.

Answer:

Scientific theories

Explanation:

Felipe drives his car at a velocity of 28 m/s. He applies the brake, which slows the vehicle down at a rate of 6.4 m/s2 and causes it to slow to a stop. How long does it take for the car to stop? Round your answer to the nearest tenth.
I'm supposed to use derived formulas to find the answer but I don't know which one to use.

Answers

So after ~4.4 seconds, car will stop.
The answer is: 4.4 seconds

A group of atoms with aligned magnetic poles are known as which of the following?
A. current
B. poles
C. domains
D. fields ...?

Answers

A magnetic domain is a group of atoms aligns with magnetic poles. Domains are usually light and dark stripes visible within each grain.

Answer:

The correct answer is option C. "domains".

Explanation:

The regions within a magnet at which the magnetization is in a uniform direction are known as magnetic domains. These domains are group of atoms with aligned magnetic poles, this means that the magnetic moments of the atoms are aligned and that their point to the same direction. The magnetic domains are the ones that give the magnetic behavior of ferromagnetic materials.

Which of the following statements is true for a cell placed in beaker containing an isotonic solution?

Select one of the options below as your answer:



A.
Water molecules flow from the cell into the beaker.




B.
Water molecules flow from the beaker into the cell.




C.
Water molecules flow in both directions at the same rate.




D.
There is no movement of water molecules.
....i dont even know how to nswer this one becasue i dont know wht and isotonic solution means

Answers

An isotonic solution is a solution in which concentration or solute is equal to that of a cell placed in it. Thus, the system is in dynamic equilibrium, and so water molecules flow in both directions.
The correct answer is C. water molecules flow in both directions at the same rate.

Which of the following is a difference between a mercury barometer and an aneroid barometer?
a. The mercury barometer is smaller
b. The mercury barometer can provide a continuous record of pressure changes
c. The aneroid barometer does not use mercury to measure pressure changes
d. The aneroid barometer is not as portable

Answers

The key difference between a mercury and an aneroid barometer is that an aneroid barometer does not use mercury to measure pressure changes, instead utilizing a mechanical metal chamber that expands and contracts in response to atmospheric pressure.

An aneroid barometer measures pressure changes without the need of mercury, which is how it differs from a mercury barometer. A mercury barometer consists of a glass tube filled with mercury, measuring atmospheric pressure by the height of the mercury column. In contrast, an aneroid barometer uses a sealed, evacuated and flexible metal chamber known as an aneroid cell, which expands and contracts with atmospheric pressure changes. These mechanical movements are then translated into pressure readings.

Comparatively speaking, the statement 'The aneroid barometer does not use mercury to measure pressure changes' is the correct difference between the two types of barometers. Therefore, the answer to the student's question is option (c).

Barometers using water are impractical because they would need to be extremely tall, over 30 feet, due to water's lower density compared to mercury, which allows for a more compact design in mercury barometers.

What happens to light that shines on an object but is not transmitted?

A. It is scattered or refracted.

B. It is polarized or absorbed.

C. It is reflected or refracted.

D. It is reflected or absorbed.

Answers

The answer is it is reflected or absorbed, so D. 

physical science help please!
I will up-vote all answers!


The Periodic Table is organized so that atoms of elements with the same number of valence electrons are in __________.



cells

columns

diagonals

rows

Answers

columns- i know this because i took a similar quiz recently :)
Hope that helps :)

Answer:

Columns

Explanation:

The groups are arranged in columns on the Periodic Table.

A wave has a wavelength of 45 meters and a period of 9.0 seconds. What is the frequency of the wave?

Answers

frequency is the reciprocal of period

f = 1/9 = 0.11 Hz

Answer: The correct answer is 0.11 Hz.

Explanation:

The relation between frequency of the wave and time period is as follows;

[tex]f=\frac{1}{T}[/tex]

Here, f is the frequency of the wave and T is the time period.

Here, the frequency is inversely proportional to the time period.

It is given in the problem that a wave has a wavelength of 45 meters and a period of 9.0 seconds.

Calculate the frequency of the wave.

[tex]f=\frac{1}{T}[/tex]

Put T= 9 s.

[tex]f=\frac{1}{9}[/tex]

f=0.11 Hz

Therefore, the frequency of the wave is 0.11 Hz.

Frequency is measured in units called?

Answers

The frequency, f, of a wave is the number of waves passing a point in a certain time. We normally use a time of one second, so this gives frequency the unit hertz (Hz), since one hertz is equal to one wave per second.

The frequency of a wave is the inverse of time period. Hence, its unit is s⁻¹ which is equivalent to Hz unit. The standard unit of frequency is Hz.

What is frequency ?

Frequency of an event is the number of cycles of that event per unit time. For a wave frequency is the number of wave cycles per second. Hence, frequency is the inverse of time period.

Frequency of a wave is directly proportional to the energy of the wave and inversely proportional to the wavelength. Hence, the high frequency waves are shorter waves.

The unit of frequency is called Hertz (Hz) which is equal to s⁻¹ because, it is the frequency is inverse of the time period of the wave. Therefore, frequency is measured in units called Hertz.

Find more on frequency:

https://brainly.com/question/14316711

#SPJ2

What type of machine is a seesaw?



A.
simple machine

B.
compound machine

Answers

Answer: Option (A) is the correct answer.

Explanation:

A seesaw is a simple machine which has a long board and on a fixed part it is balanced in the middle.

For example, a seesaw on which children play in the park is balanced at the middle on a fixed point so that children sitting on both the sides can move up and down with the same force.

Thus, we can conclude that seesaw is a simple machine type of machine.

Seesaw is classified as a simple machine. The correct option is( A)

What is simple machine ?

A seesaw is categorized as a basic machine since it functions using the levering principle. One of the six traditional simple machines, together with the inclined plane, wedge, screw, wheel and axle, and pulley is the lever.

The lever in the case of a seesaw is a long, rigid beam that pivots on a fulcrum. A back-and-forth motion is possible because of the effort put in on one end of the seesaw, which forces the other end to rise and fall.

Therefore, The correct option is ( A)

Learn more about simple machine here :brainly.com/question/31090053

#SPJ6

A 0.150 kg ball on the end of a 1.10 m long cord (negligible mass)is swung in a vertical circle..

(a) what is the minimum speed the ball must have at the top of its arc so that the ball continues moving in a circle?
calculate the tension in the cord at the bottom of the arc assuming the ball is moving at twice the speed of part (a) ...?

Answers

For any body to move in a circle it requires the centripetal force (mv^2)/r. In this case a ball is moving in a vertical circle swung by a mass less cord. At the top of its arc if we draw its free body diagram and equate the forces in radial direction to the centripetal force we get it as T +mg =(mv^2)/r T is tension in cord m is mass of ball r is length of cord (radius of the vertical circle) To get the minimum value of velocity the LHS should be minimum. This is possible when T = 0. So minimum speed of ball v at top =sqrtr(rg)=sqrt(1.1*9.81) = 3.285 m/s In the second case the speed of ball at top = (2*3.285) =6.57 m/s Let us take the lowest point of the vertical circle as reference for potential energy and apllying the conservation of energy equation between top & bottom we get velocity at bottom as 9.3m/s. Now by drawing the free body diagram of the ball at the bottom and equating the net radial force to the centripetal force T-mg=(mv^2)/r We get tension in cord T=13.27 N

Answer:

[tex]v = 3.28 m/s[/tex]

Explanation:

At the top position of the arc if ball continue in its circular path then we can say that tension force must be zero at that position for the minimum value of the speed.

So we will have

[tex]T + mg = \frac{mv^2}{R}[/tex]

so if minimum speed is required to complete the circle T = 0

[tex]0 + mg = \frac{mv^2}{R}[/tex]

so we will have

[tex]v = \sqrt{Rg}[/tex]

again we will have

[tex]v = \sqrt{1.10\times 9.81}[/tex]

[tex]v = 3.28 m/s[/tex]

what is the energy of a photon whose frequency is 5.2 x 10 to the 15th s -1? Cassie(:

Answers

E=hf
Where h is constant
h - Planck constant
f - frequiency

E equals 6.626 times 10 in the minus 34th times 5.2 times 10 in the 15th

Equals 3.44552 time 10 in the minus 18th

can someone check my answer thanks ! 2.The ability to do work or cause change is called A.velocity. B.energy.(I PICK B.) C.transfer. D.friction. 3.Which type of energy is demonstrated by a person jogging?
A.electrical energy B.nuclear energy C.electromagnetic energy D.kinetic energy(I PICK D) 4.Which is the type of energy available in food? A.electromagnetic B.gravitational C.chemical(I PICK C) D.kinetic 5.Dan does 188.0 J of work raking leaves. If the rake does 128.0 J of work, what is the efficiency of the rake?
A.68.1 percent(I PICK A) B.147.0 percent C.60.0 percent D.316.0 percent 6.Which type of energy transformation is taking place when natural gas is used to heat water?
A.chemical energy into thermal energy(I PICK A) B.thermal energy into mechanical energy C.mechanical energy into electromagnetic energy D.electromagnetic energy into chemical energy 7.The energy associated with the motion and position of an object is called
A.kinetic energy. B.potential energy. C.gravitational potential energy. D.mechanical energy.(I PICK D) ****I ACTUALLY HAD 2 CHOICES FOR 7 SO MY OTHER ANSWER IS A*****

Answers

Answer:

2. B. energy

3. D.kinetic energy

4. C. chemical

5. A.68.1 percent

6. A.chemical energy into thermal energy

7. D.mechanical energy

Explanation:

2. Energy is  the ability of matter to produce work in the form of movement, light, heat, etc.

3.  The kinetic energy of a body is that energy it possesses due to its movement.

4 .Chemical energy is the energy stored in the bonds of chemical compounds (atoms and molecules).

5. Efficiency can be calculated as (128J/188J)*100= 68%

6. Chemical energy is defined in item 4 and thermal energy is a type of energy that bodies possess when exposed to the effect of heat. It is precisely what produces that the atoms that make up the molecules are in constant motion either moving or vibrating.

7. Mechanical energy is the energy that bodies present because of their movement (kinetic energy), and their situation with respect to another body, usually the earth.

Final answer:

All your selected answers are correct. The ability to do work is energy, a person jogging has kinetic energy, energy in food is chemical, the rake has 68.1 percent efficiency, natural gas heating water is a chemical to thermal energy transformation process, and motion and position of an object relate to mechanical energy.

Explanation:

Yes, you are correct with your answers. The ability to do work or cause change is indeed called B.energy. A person jogging demonstrates D.kinetic energy as they are in motion. The type of energy available in food is C.chemical energy which is stored and can be transformed into other energy forms our body needs. With the work done raking leaves, if Dan does 188.0 J of work and the rake itself does 128.0 J of work then the efficiency of the rake would be (128.0 / 188.0) * 100 = 68.1 percent, hence, it is A.68.1 percent. The transformation of energy taking place when natural gas is used to heat water is A. Chemical energy into thermal energy. Finally, the energy associated with the motion and position of an object falls under D. mechanical energy, although if considering only the motion aspect, it is indeed A. Kinetic energy.

Learn more about Energy here:

https://brainly.com/question/36891624

#SPJ6

The strength of the force of gravity depends on a. the masses of the objects and their speeds. b. the masses of the objects and the distance between them. c. the weight of the objects and their speeds. d. the masses of the objects and their weights.

Answers

Gravitational force = Gxm1xm2 /r^2 This equation depends only upon object's masses and distance between them. So option b is correct

Why is a protective apron or lab coat important to use when working with acids?

Answers

It helps protect against harm to skin. For example hydrochloride acid is toxic and it is a good idea to cover up when using or dealing with chemicals of all kinds.

Answer:

c

Explanation:

At the beginning of a basketball game, a referee tosses the ball straight up with a speed of 4.6 m/s. A player cannot touch the ball until after it reaches its max height and begins to fall down. What is the minimum time that a player must wait before touching the ball?

Answers

Final answer:

The minimum time a player must wait before touching the basketball after it has been tossed straight up by the referee is approximately 0.469 seconds, which is the time taken for the ball to reach its maximum height.

Explanation:

The student is asking about the time it takes for an object (a basketball in this case) to reach its maximum height when thrown vertically upwards. This situation can be analyzed using the equations of motion under constant acceleration due to gravity. Since gravity will be slowing down the ball until it stops and starts falling, we can use the initial velocity and the acceleration due to gravity to find the time taken to reach the maximum height.

Using the equation v = u + at, where v is the final velocity (0 m/s at the maximum height), u is the initial upward velocity (4.6 m/s), a is the acceleration due to gravity (-9.8 [tex]m/s^2[/tex]), and t is the time in seconds, we can solve for t. Here, the negative sign for acceleration indicates that gravity is acting opposite to the direction of the initial velocity.

Substituting the known values, we get:

0 = 4.6 m/s - (9.8 [tex]m/s^2[/tex] × t)

t = 4.6 m/s / 9.8 [tex]m/s^2[/tex]

t = 0.469 seconds (rounded to three decimal places)

This is the time for the ball to reach the peak of its motion. To find the minimum time that a player must wait before touching the ball, we just consider this time, since the ball starts to fall immediately after reaching its maximum height.

In an electrical circuit, which of the following controls whether or not electrons flow through the circuit?

Answers

A SWITCH. IT controls the flow of electrons in a circuit

Other Questions
Convert 3/5 to a percent Which of the following conditions is unaffected by physical activity? A. type 2 diabetes B. hypertension C. skin cancer D. depression Please select the best answer from the choices provided. A B C D how do earthworms get rid of nitrogenous wastes? Reg sells cars. he makes a base salary of $25,000, plus $1500 per car he sells. the function that models this situation is s = 1500x 25000. after working at the car dealership for 2 years, he gets a raise. he now makes $1700 per car he sells. what is the new function that models this situation? Marta walked at 3.9 miles per hour for 0.72 hours. How far did she walk? Trees,walls, and fence post leaning downhill are signs of ? A rockfalls B mud flow C Creep D slump ? When and why did Congress form a new southern army? carlos has a string that is 24 inches long. he wants to divide it into 3 equal parts. write an equation to find how long each part will be. use ? to represent the unknow number. then solve your equation. The abstract is a concise summary of the key points of your research.1.True2.False In a machine shop, two cams are produced, one of aluminum and one of iron. Both cams have the same mass. Which cam is larger? (a) the aluminum cam (b) the iron cam (c) Both cams have the same size. ...? What is a limitation of first-person narration in a story? A.The reader is too far removed from the story's action. B.The reader does not feel a connection to the narrator. C.The thoughts of too many characters are displayed. D.The other characters' views and thoughts are left out. What might inspire a highly educated chinese scholar to compose such a flattering public tribute to a mongol official? The table shows the result of a restaurant survey.Meals Service Good Service poor TotalLunch 49 39 88Dinner 19 15 34Total 68 54 122Find the probability the service was poor, given that the meal was dinner. the black snake poem by patricia hubbell uses figurative language to create meaning. describe how how similes and metaphors create meaning or communicate theme in the story use specific details from the passage Sarah is keeping up with how many miles her car gets per gallon. She starts with a full tank. After 448 miles, she fills up with 14 gallons. If she plots the points (0,0) and (14,448) on a coordinate plane, what would be the y-value of the point (1,y)? In rock layers, jellyfish fossils are found lower than trilobite fossils, and trilobite fossils are found lower than ammonite fossils. What can be determined from this information? On average, sloths spend 16.5 hours per day sleeping. what percent of the day do sloths spend sleeping? round your answer to the nearest percent. on saturday, a minor league baseball team gave away baseball cards to each person entering the stadium. one group received 28 baseball cards. a second group received 68 baseball cards. if each person entering the stadium received the same number of cards, what was the greatest possible number of baseball cards that each person could have received? How are transgenic organisms different from natural organisms of the same species? In act i, scene v of romeo and juliet. the adaptation needs revision because it what? Steam Workshop Downloader